CAS 17662-84-9: D-Valine benzy ester 4-methylbenzenesulfonate
Description:D-Valine benzy ester 4-methylbenzenesulfonate, with the CAS number 17662-84-9, is a chemical compound that belongs to the class of amino acid derivatives. It features a valine amino acid moiety, which is an essential branched-chain amino acid, esterified with a benzyl group, and is further sulfonated with a 4-methylbenzenesulfonate group. This compound is typically characterized by its white to off-white crystalline appearance and is soluble in organic solvents. Its structure imparts specific properties, such as potential applications in pharmaceuticals and biochemistry, particularly in peptide synthesis and as a building block for more complex molecules. The presence of the sulfonate group enhances its solubility and reactivity, making it useful in various chemical reactions. Additionally, the compound may exhibit biological activity due to the valine component, which is crucial for protein synthesis and metabolic processes. As with many chemical substances, handling should be done with care, following appropriate safety protocols to mitigate any potential hazards.
Formula:C19H25NO5S
InChI:InChI=1/C12H17NO2.C7H8O3S/c1-9(2)11(13)12(14)15-8-10-6-4-3-5-7-10;1-6-2-4-7(5-3-6)11(8,9)10/h3-7,9,11H,8,13H2,1-2H3;2-5H,1H3,(H,8,9,10)/t11-;/m1./s1
- Synonyms:
- H-D-Val-Obzl P-Tosylate
- H-D-Val-Obzl Tos-Oh
- D-Valine Benzyl Ester 4-Toluenesulfonate Salt
- D-Valine Benzyl Ester P-Tosylate
- D-Valine-Obzl P-Tosylate
- D-Valine benzyl ester tosylate
- D-Valine Benzyl Ester p-Toluenesulfonate
- H-D-Val-OBzl・TosOH
- D-Valine benzyl ester 4-toluenesulfonate