CAS 17663-87-5
:γ-Glutamylmethionine
Description:
γ-Glutamylmethionine is a dipeptide composed of the amino acids glutamic acid and methionine, linked by a peptide bond. It is characterized by the presence of a γ-carboxyl group from the glutamic acid, which distinguishes it from other forms of glutamyl compounds. This compound plays a role in various biological processes, including protein synthesis and cellular metabolism. It is often studied for its potential antioxidant properties and its involvement in the regulation of cellular functions. γ-Glutamylmethionine can be found in certain foods and is also of interest in nutritional and pharmaceutical research. Its solubility in water and stability under physiological conditions make it relevant for various applications in biochemistry and nutrition. Additionally, the compound's structure allows it to participate in various biochemical pathways, contributing to the synthesis of other important biomolecules. Overall, γ-Glutamylmethionine is a significant compound in the context of amino acid metabolism and cellular health.
Formula:C10H18N2O5S
InChI:InChI=1S/C10H18N2O5S/c1-18-5-4-7(10(16)17)12-8(13)3-2-6(11)9(14)15/h6-7H,2-5,11H2,1H3,(H,12,13)(H,14,15)(H,16,17)/t6-,7-/m0/s1
InChI key:InChIKey=RQNSKRXMANOPQY-BQBZGAKWSA-N
SMILES:[C@H](NC(CC[C@@H](C(O)=O)N)=O)(CCSC)C(O)=O
Synonyms:- L-Methionine, N-L-γ-glutamyl-
- Methionine, N-L-γ-glutamyl-
- L-Methionine, L-γ-glutamyl-
- Methionine, N-L-γ-glutamyl-, L-
- L-γ-Glutamyl-L-methionine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
H-Glu(Met-OH)-OH
CAS:γ-Glu-Met and further kokumi-active γ-glutamyl dipeptides have been isolated from mature Gouda cheese. These branched dipeptides are responsible for the complex taste of the cheese.Formula:C10H18N2O5SPurity:> 99%Color and Shape:WhiteMolecular weight:278.33H-Glu(Met-OH)-OH
CAS:H-Glu(Met-OH)-OH is an enzyme that catalyzes the conversion of stachyose to sucrose. It is also a synthetase that catalyzes the formation of fatty acids. H-Glu(Met-OH)-OH has been shown to be active in cancer cells and may be used as a potential therapeutic target for cancer treatment. This enzyme is inhibited by sodium hydroxide solution, hydrochloric acid, and urea nitrogen. The activity of H-Glu(Met-OH)-OH is measured by its ability to synthesize fatty acids from glucose in the presence of ATP and NADPH. Hydroxide solution can also be used to measure the activity of H-Glu(Met-OH)-OH as it converts stachyose to sucrose in the presence of ATP, NADP+, and sodium hydroxide solution. The rate at which this reaction occurs can be measured using a spectrophotometer with a carboxylate absorbFormula:C10H18N2O5SPurity:Min. 95%Color and Shape:SolidMolecular weight:278.33 g/mol


