CAS 17664-93-6: H-D-LEU-OBZL P-TOSYLATE
Description:H-D-LEU-OBZL P-TOSYLATE, with the CAS number 17664-93-6, is a chemical compound that serves as a derivative of leucine, an essential amino acid. This substance is characterized by its structure, which includes a leucine residue protected by a benzyl group (OBZL) and a tosylate group (P-TOSYLATE) that enhances its reactivity and solubility in organic solvents. The presence of the tosylate moiety makes it a useful intermediate in organic synthesis, particularly in peptide chemistry, where it can facilitate the formation of peptide bonds. The compound is typically used in research and pharmaceutical applications, particularly in the synthesis of peptide-based drugs. Its stability, solubility, and reactivity are influenced by the functional groups present, making it a valuable building block in the development of more complex molecules. As with many chemical substances, proper handling and storage conditions are essential to maintain its integrity and ensure safety during use.
Formula:C20H27NO5S
InChI:InChI=1/C13H19NO2.C7H8O3S/c1-10(2)8-12(14)13(15)16-9-11-6-4-3-5-7-11;1-6-2-4-7(5-3-6)11(8,9)10/h3-7,10,12H,8-9,14H2,1-2H3;2-5H,1H3,(H,8,9,10)/t12-;/m1./s1
- Synonyms:
- D-Leucine Benzyl Ester 4-Toluenesulfonate Salt
- D-Leucine Benzyl Ester P-Toluenesulfonate Salt
- D-Leucine Benzyl Ester-P-Tosylate
- D-Leucine Benzyl Ester Tosylate
- D-Leucine-Obzl P-Tosylate
- H-D-Leu-Obzl Ptsa
- H-D-Leu-Obzl Tos
