CymitQuimica logo

CAS 176650-92-3

:

3,5-BIS(3,5-DIMETHOXYBENZYLOXY)BENZYL ALCOHOL

Description:
3,5-Bis(3,5-dimethoxybenzyloxy)benzyl alcohol is an organic compound characterized by its complex structure, which includes multiple methoxy groups and a benzyl alcohol moiety. This compound features a central benzene ring substituted at the 3 and 5 positions with 3,5-dimethoxybenzyloxy groups, enhancing its solubility and reactivity. The presence of the hydroxyl (-OH) group in the benzyl alcohol portion contributes to its potential as a versatile intermediate in organic synthesis, particularly in the development of pharmaceuticals and fine chemicals. The methoxy groups can influence the compound's electronic properties, potentially affecting its reactivity and interaction with biological systems. Additionally, the compound may exhibit interesting physical properties, such as solubility in organic solvents and possible applications in materials science. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound may not be fully characterized. Overall, 3,5-bis(3,5-dimethoxybenzyloxy)benzyl alcohol represents a unique structure with potential applications in various chemical fields.
Formula:C25H28O7
InChI:InChI=1/C25H28O7/c1-27-20-7-18(8-21(11-20)28-2)15-31-24-5-17(14-26)6-25(13-24)32-16-19-9-22(29-3)12-23(10-19)30-4/h5-13,26H,14-16H2,1-4H3
InChI key:TWHQMXZJXJJPKN-UHFFFAOYSA-N
SMILES:COc1cc(cc(c1)OC)COc1cc(cc(c1)OCc1cc(cc(c1)OC)OC)CO
Found 4 products.