CymitQuimica logo

CAS 176673-72-6

:

4-Chloro-3,5-difluorobromobenzene

Description:
4-Chloro-3,5-difluorobromobenzene is an aromatic halogenated compound characterized by the presence of chlorine, fluorine, and bromine substituents on a benzene ring. The compound features a bromine atom at the para position relative to a chlorine atom and two fluorine atoms at the meta positions. This specific arrangement of halogens contributes to its unique chemical properties, including increased reactivity and potential applications in various fields such as pharmaceuticals and agrochemicals. The presence of multiple electronegative halogens can influence the compound's polarity, solubility, and reactivity, making it a subject of interest in synthetic organic chemistry. Additionally, the compound may exhibit distinct physical properties, such as a specific boiling point and melting point, which are influenced by the halogen substituents. Safety considerations are important when handling this compound, as halogenated aromatic compounds can pose environmental and health risks. Overall, 4-Chloro-3,5-difluorobromobenzene serves as a valuable building block in chemical synthesis and research.
Formula:C6H2BrClF2
InChI:InChI=1S/C6H2BrClF2/c7-3-1-4(9)6(8)5(10)2-3/h1-2H
InChI key:SWELJVAWQMCJLG-UHFFFAOYSA-N
SMILES:C1=C(C=C(C(=C1F)Cl)F)Br
Synonyms:
  • 5-Bromo-2-Chloro-1,3-difluorobenzene
  • 1-Bromo-4-Chloro-3,5-difluorobenzene
Found 4 products.