CAS 176690-44-1

2-PYRIDIN-3-YL-BENZALDEHYDE

Description:

2-Pyridin-3-yl-benzaldehyde, with the CAS number 176690-44-1, is an organic compound characterized by the presence of both a pyridine and a benzaldehyde functional group. It features a pyridine ring substituted at the 3-position with a benzaldehyde moiety, which contributes to its aromatic properties. This compound typically appears as a yellow to brown solid or liquid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in various chemical reactions, such as condensation and substitution reactions. The presence of the electron-withdrawing pyridine ring can influence the reactivity and stability of the compound, making it a valuable intermediate in synthetic chemistry. Additionally, 2-pyridin-3-yl-benzaldehyde may exhibit biological activity, although specific biological properties would require further investigation. As with many organic compounds, proper handling and safety precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₂H₉NO

InChI: InChI=1/C12H9NO/c14-9-11-4-1-2-6-12(11)10-5-3-7-13-8-10/h1-9H

SMILES: c1ccc(c2cccnc2)c(c1)C=O

Synonyms:

• 2-(3-Pyridinyl)Benzaldehyde
• 2-(3-Pyridyl)Benzaldehyde
• Akos Bar-0415
• 2-(3-Pyrldinyl)benzaldehyde
• 2-(Pyridin-3-yl)benzaldehyde 97%
• 2-Pyridin-3-Yl-Benzaldehyde, 95+%

Benzaldehyde, 2-(3-pyridinyl)-

CAS: 176690-44-1

Formula: C₁₂H₉NO

Purity: 95%

Color and Shape: Solid

Molecular weight: 183.2060

Ref: IN-DA0024TG

2-(Pyridin-3-yl)benzaldehyde

CAS: 176690-44-1

2-(Pyridin-3-yl)benzaldehyde

Purity: 95%

Color and Shape: Pale Yellow Powder

Molecular weight: 183.21g/mol

Ref: 54-OR12527

2-Pyridin-3-yl-benzaldehyde

CAS: 176690-44-1

Formula: C₁₂H₉NO

Purity: 96%

Color and Shape: Solid

Molecular weight: 183.21

Ref: 10-F077740