CAS 17676-20-9
:methyl 2-deoxypentopyranoside
Description:
Methyl 2-deoxypentopyranoside is a carbohydrate derivative characterized by its structure, which includes a five-carbon sugar (pentose) with a methyl group attached to the hydroxyl group of the anomeric carbon. This compound is a glycoside, meaning it has a sugar moiety linked to a non-sugar moiety via a glycosidic bond. The "2-deoxy" designation indicates that it lacks a hydroxyl group at the second carbon, which is a common modification in sugar chemistry that can influence the compound's reactivity and biological activity. Methyl 2-deoxypentopyranoside is typically a white to off-white solid and is soluble in polar solvents like water and methanol. Its applications may include use in biochemical research, particularly in studies involving glycosylation reactions or as a building block in the synthesis of more complex carbohydrates. The compound's properties, such as melting point, boiling point, and specific reactivity, can vary based on its purity and the conditions under which it is handled.
Formula:C6H12O4
InChI:InChI=1/C6H12O4/c1-9-6-2-4(7)5(8)3-10-6/h4-8H,2-3H2,1H3
SMILES:COC1CC(C(CO1)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Decitabine Impurity 4 (Methyl 2-deoxy-β-D-Ribopyranoside)
CAS:Formula:C6H12O4Color and Shape:White To Off-White SolidMolecular weight:148.16Methyl 2-deoxy-b-D-ribopyranoside
CAS:<p>Methyl 2-deoxy-b-D-ribopyranoside is a synthetic monosaccharide that has been modified by fluorination, monosaccharide, and methylation. It is an oligosaccharide that belongs to the group of complex carbohydrates. This compound can be used for glycosylation reactions or as a sugar donor in click chemistry. Methyl 2-deoxy-b-D-ribopyranoside has CAS No. 17676-20-9 and it's purity is greater than 99%.</p>Formula:C6H12O4Purity:Min. 95%Molecular weight:148.16 g/mol
