CAS 17676-33-4: spirosta-5,25(27)-diene-1β,3β-diol
Description:Spirosta-5,25(27)-diene-1β,3β-diol is a steroidal compound characterized by its unique spiro structure, which consists of a fused ring system that includes a cyclopentane and a steroid backbone. This compound features hydroxyl groups at the 1β and 3β positions, contributing to its potential biological activity. The presence of the diene configuration indicates that it has two double bonds within its structure, which can influence its reactivity and interactions with biological systems. Typically, such compounds may exhibit various pharmacological properties, including potential hormonal activity, due to their structural similarity to steroid hormones. The specific stereochemistry of the hydroxyl groups is crucial for its biological function, as it can affect receptor binding and activity. Additionally, spiro compounds often display interesting conformational properties, which can impact their solubility and stability. Overall, spirosta-5,25(27)-diene-1β,3β-diol represents a class of compounds that may have significant implications in medicinal chemistry and pharmacology.
Formula:C27H40O4
InChI:InChI=1S/C27H40O4/c1-15-7-10-27(30-14-15)16(2)24-22(31-27)13-21-19-6-5-17-11-18(28)12-23(29)26(17,4)20(19)8-9-25(21,24)3/h5,16,18-24,28-29H,1,6-14H2,2-4H3/t16-,18+,19+,20-,21-,22-,23+,24-,25-,26-,27+/m0/s1
InChI key:InChIKey=ALTRINCJVPIQNK-NHIXJPGBSA-N
SMILES:OC1CC2=CCC3C(CCC4(C)C3CC5OC6(OCC(=C)CC6)C(C)C54)C2(C)C(O)C1
- Synonyms:
- (1Beta,3Beta)-Spirosta-5,25(27)-Dien-1,3-Diol
- (1β,3β)-Spirosta-5,25(27)-diene-1,3-diol
- 25(27)-Dehydroruscogenin
- Neoruscogenin
- Spirosta-5,25(27)-Dien-1,3-Diol
- Spirosta-5,25(27)-diene-1,3-diol, (1β,3β)-
- Spirosta-5,25(27)-diene-1beta,3beta-diol
