CAS 17676-65-2
:5-chlorocytosine arabinoside*crystalline
Description:
5-Chlorocytosine arabinoside, with the CAS number 17676-65-2, is a nucleoside analog that incorporates a chlorinated cytosine base into an arabinose sugar moiety. This compound is characterized by its structural similarity to natural nucleosides, which allows it to interfere with nucleic acid synthesis. It exhibits antimetabolite properties, making it of interest in the field of cancer therapy and antiviral treatments. The crystalline form of this substance indicates that it has a well-defined solid-state structure, which can influence its solubility and bioavailability. Typically, such compounds are evaluated for their pharmacological activity, stability, and potential side effects. The presence of the chlorine atom in the cytosine base can enhance its biological activity compared to unmodified nucleosides. Additionally, the arabinose sugar configuration may affect the compound's interaction with nucleic acid polymerases and its incorporation into DNA or RNA. Overall, 5-chlorocytosine arabinoside represents a significant area of research in medicinal chemistry and pharmacology.
Formula:C9H12ClN3O5
InChI:InChI=1/C9H12ClN3O5/c10-3-1-13(9(17)12-7(3)11)8-6(16)5(15)4(2-14)18-8/h1,4-6,8,14-16H,2H2,(H2,11,12,17)/t4-,5-,6+,8-/m1/s1
Synonyms:- 4-amino-5-chloro-1-pentofuranosylpyrimidin-2(1H)-one
- 4-amino-1-beta-D-arabinofuranosyl-5-chloropyrimidin-2(1H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
5-Chloro-1-(b-D-arabinofuranosyl)cytidine
CAS:<p>5-Chloro-1-(b-D-arabinofuranosyl)cytidine is a monophosphate that is used as a precursor in the synthesis of antiviral and anticancer drugs. 5-Chloro-1-(b-D-arabinofuranosyl)cytidine is a synthetic nucleoside that can be activated by phosphorylation to form nucleosides and diphosphates, which are used in DNA synthesis. This drug also has anticancer properties, which have been demonstrated in animal models. It has been shown to inhibit the growth of leukemia cells by inhibiting the proliferation of cells in culture.</p>Formula:C9H12CIN3O5Purity:Min. 95%Molecular weight:277.66 g/mol

