CAS 17678-19-2
:2-Furylhydroxymethylketone
Description:
2-Furylhydroxymethylketone, with the CAS number 17678-19-2, is an organic compound characterized by its furan ring structure, which contributes to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It features a hydroxymethyl group and a ketone functional group, which are responsible for its reactivity and potential applications in organic synthesis. The presence of the furan ring imparts aromatic characteristics, making it a candidate for various chemical reactions, including electrophilic substitutions and nucleophilic additions. 2-Furylhydroxymethylketone is often studied for its potential use in pharmaceuticals, agrochemicals, and as an intermediate in the synthesis of more complex organic molecules. Its solubility in organic solvents and moderate stability under standard conditions make it a versatile compound in laboratory settings. However, as with many organic compounds, it is essential to handle it with care, considering safety data and potential hazards associated with its use.
Formula:C6H6O3
InChI:InChI=1/C6H6O3/c7-4-5(8)6-2-1-3-9-6/h1-3,7H,4H2
SMILES:c1cc(C(=O)CO)oc1
Synonyms:- Ethanone, 1-(2-furanyl)-2-hydroxy-
- 1-(Furan-2-Yl)-2-Hydroxyethanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Ethanone, 1-(2-furanyl)-2-hydroxy-
CAS:Formula:C6H6O3Purity:95%Color and Shape:SolidMolecular weight:126.1100Furyl Hydroxymethyl Ketone
CAS:Controlled Product<p>Applications Furyl Hydroxymethyl Ketone is a reagent in the preparation of 3-iodocoumarins. Also used in the preparation of quinoxalines generally used in dyes and pharmaceuticals.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Reddy, M. et al.: J. Org. Chem., 78, 5878 (2013); Cho, C. et al.: J. Mol. Catal. A. Chem., 276, 205 (2007);<br></p>Formula:C6H6O3Color and Shape:NeatMolecular weight:126.11
