CAS 1768-31-6
:pentachloroacetone
Description:
Pentachloroacetone, with the CAS number 1768-31-6, is an organic compound characterized by its structure, which includes five chlorine atoms attached to an acetone backbone. This compound is typically a colorless to pale yellow liquid with a pungent odor. It is known for its high reactivity, particularly due to the presence of multiple electronegative chlorine atoms, which can influence its chemical behavior and interactions. Pentachloroacetone is primarily used in organic synthesis and as a reagent in various chemical reactions, including chlorination processes. It is also recognized for its potential applications in the production of other chlorinated compounds. However, due to its toxicity and environmental concerns, handling requires appropriate safety measures, including the use of personal protective equipment and proper ventilation. Its physical properties, such as boiling point and solubility, are influenced by its chlorinated nature, making it a compound of interest in both industrial and research settings.
Formula:C3HCl5O
InChI:InChI=1/C3HCl5O/c4-2(5)1(9)3(6,7)8/h2H
InChI key:InChIKey=RVSIFWBAGVMQKT-UHFFFAOYSA-N
SMILES:C(C(Cl)(Cl)Cl)(C(Cl)Cl)=O
Synonyms:- 1,1,1,3,3-Pentachloro-2-propanone
- 1,1,1,3,3-Pentachloroacetone
- 1,1,1,3,3-Pentachloropropan-2-One
- 1,1,1,3,3-Pentachloropropanone
- 2-Propanone, 1,1,1,3,3-pentachloro-
- 2-Propanone, pentachloro-
- Brn 1766425
- Ccris 7472
- Pentachloro-2-propanone
- Pentachloropropanone
- Pentachloroacetone
- Pentachloroacetone
- Pentachloropropan-2-One
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Pentachloroacetone
CAS:Controlled Product<p>Stability Moisture Sensitive<br>Applications Pentachloroacetone is a disinfection byproduct.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Jeong, C., et al.: Environ. Sci. Technol., 46, 12120 (2012); Colman, J., et al.: Toxicol. Appl. Pharm., 254, 100 (2011)<br></p>Formula:C3HCl5OColor and Shape:NeatMolecular weight:230.30

