CAS 17682-71-2
:2,3-O-(1-Methylethylidene)-α-L-sorbofuranose
Description:
2,3-O-(1-Methylethylidene)-α-L-sorbofuranose is a carbohydrate derivative characterized by its unique structural features. This compound is a furanose form of sugar, which means it contains a five-membered ring structure that includes an oxygen atom. The presence of the methylethylidene group at the 2 and 3 positions indicates that it has been modified to enhance its stability and reactivity compared to its parent sugar. This modification can influence its solubility, reactivity, and potential applications in organic synthesis or as a biochemical reagent. The α configuration at the anomeric carbon suggests that the hydroxyl group is oriented downward in the Haworth projection, which is significant for its biological interactions. Additionally, the compound's CAS number, 17682-71-2, allows for precise identification in chemical databases. Overall, 2,3-O-(1-Methylethylidene)-α-L-sorbofuranose is of interest in both synthetic chemistry and potential applications in pharmaceuticals or biochemistry due to its structural properties.
Formula:C9H16O6
InChI:InChI=1S/C9H16O6/c1-8(2)14-7-6(12)5(3-10)13-9(7,4-11)15-8/h5-7,10-12H,3-4H2,1-2H3/t5-,6+,7-,9-/m0/s1
InChI key:InChIKey=AVVCILZWWPKOLD-XQXXSGGOSA-N
SMILES:C(O)[C@]12[C@]([C@H](O)[C@H](CO)O1)(OC(C)(C)O2)[H]
Synonyms:- 2,3-O-(1-Methylethylidene)-α-<span class="text-smallcaps">L</span>-sorbofuranose
- 2,3-O-(1-methylethylidene)-alpha-L-sorbofuranose
- 2,3-O-Isopropylidene-α-<span class="text-smallcaps">L</span>-sorbofuranose
- Furo[2,3-d]-1,3-dioxole, α-<span class="text-smallcaps">L</span>-sorbofuranose deriv.
- Sorbofuranose, 2,3-O-isopropylidene-, α-<span class="text-smallcaps">L</span>-
- alpha-l-Sorbofuranose, 2,3-O-(1-methylethylidene)-
- α-<span class="text-smallcaps">L</span>-Sorbofuranose, 2,3-O-(1-methylethylidene)-
- 2,3-O-Isopropylidene-α-L-sorbofuranose
- 2,3-O-(1-Methylethylidene)-α-L-sorbofuranose
- Sorbofuranose, 2,3-O-isopropylidene-, α-L-
- α-L-Sorbofuranose, 2,3-O-(1-methylethylidene)-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,3-O-Isopropylidene-a-L-sorbofuranose
CAS:Formula:C9H16O6Color and Shape:SolidMolecular weight:220.21972,3-O-Isopropylidene-α-L-sorbofuranose
CAS:Controlled ProductApplications 2,3-O-Isopropylidene-α-L-sorbofuranose (cas# 17682-71-2) is a compound useful in organic synthesis.
Formula:C9H16O6Color and Shape:NeatMolecular weight:220.222,3-O-Isopropylidene-a-L-sorbofuranose
CAS:2,3-O-Isopropylidene-a-L-sorbofuranose is a furanose ring that can form both intermolecular and intramolecular hydrogen bonds. The five-membered and six-membered conformations are the most stable of the conformational isomers, although there are many different possible configurations. 2,3-O-Isopropylidene-a-L-sorbofuranose is an analog of D-(+)-fructose and has been used to produce analogs of D-(+)-fructose. This compound has also been used in carbohydrate chemistry as a reagent for the synthesis of other carbohydrates.Formula:C9H16O6Purity:Min. 95%Color and Shape:White solid.Molecular weight:220.22 g/mol



