CAS 17688-68-5: Thiomorpholine, 4-phenyl-, 1,1-dioxide

Description:Thiomorpholine, 4-phenyl-, 1,1-dioxide, also known by its CAS number 17688-68-5, is a heterocyclic organic compound characterized by a thiomorpholine ring structure that incorporates a phenyl group and a sulfone functional group. This compound features a six-membered ring containing both sulfur and nitrogen atoms, which contributes to its unique chemical properties. The presence of the sulfone group (1,1-dioxide) enhances its polarity and solubility in polar solvents, making it useful in various chemical applications. Thiomorpholine derivatives are often studied for their biological activity, including potential pharmaceutical applications, due to their ability to interact with biological systems. The compound may exhibit properties such as antimicrobial or anti-inflammatory effects, although specific biological activities can vary. Additionally, its stability and reactivity can be influenced by the substituents on the thiomorpholine ring. Overall, thiomorpholine, 4-phenyl-, 1,1-dioxide is a compound of interest in both synthetic chemistry and medicinal research.

Formula:C₁₀H₁₃NO₂S

InChI:InChI=1S/C10H13NO2S/c12-14(13)8-6-11(7-9-14)10-4-2-1-3-5-10/h1-5H,6-9H2

InChI key:InChIKey=OLQHDKQJHKZUNN-UHFFFAOYSA-N

SMILES:O=S1(=O)CCN(C=2C=CC=CC2)CC1

Synonyms:
Cerium(3+) Triacetate Hydrate
N-(Phenyl)thiomorpholine 1,1-dioxide
N-Phenylthiomorpholine S,S-dioxide
Nsc 261427
Thiomorpholine, 4-phenyl-, 1,1-dioxide

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Thiomorpholine, 4-phenyl-, 1,1-dioxide REF: IN-DA0024YBCAS: 17688-68-5	96%	113.00 €~529.00 €	Mon 14 Apr 25
4-Phenylthiomorpholine 1,1-Dioxide REF: 3B-P1603CAS: 17688-68-5	>98.0%(GC)	153.00 €~470.00 €	Thu 17 Apr 25
4-Phenylthiomorpholine 1,1-dioxide REF: 10-F639111CAS: 17688-68-5	98+%	To inquire	Thu 24 Apr 25
4-Phenylthiomorpholine 1,1-dioxide REF: 3D-SAA68868CAS: 17688-68-5	Min. 95%	- - -	Discontinued product