CAS 176909-92-5
:3a,4,5,6,7,7a-Hexahydro-1,2-benzisoxazole-3-carboxylic acid
Description:
3a,4,5,6,7,7a-Hexahydro-1,2-benzisoxazole-3-carboxylic acid, with CAS number 176909-92-5, is a bicyclic compound featuring a benzisoxazole moiety. This substance is characterized by its hexahydro structure, which indicates the presence of a saturated ring system. The carboxylic acid functional group contributes to its acidity and potential reactivity, making it useful in various chemical applications. The presence of the isoxazole ring suggests that it may exhibit biological activity, potentially serving as a scaffold for drug development. The compound's solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its practical applications. Additionally, its molecular structure may allow for interactions with biological targets, making it of interest in medicinal chemistry. Overall, this compound represents a unique combination of structural features that may confer specific chemical and biological properties.
Formula:C8H11NO3
InChI:InChI=1S/C8H11NO3/c10-8(11)7-5-3-1-2-4-6(5)12-9-7/h5-6H,1-4H2,(H,10,11)
InChI key:InChIKey=GGVIZLXGQKBSKY-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C2C(ON1)CCCC2
Synonyms:- 3a,4,5,6,7,7a-Hexahydro-1,2-benzisoxazole-3-carboxylic acid
- 1,2-Benzisoxazole-3-carboxylic acid, 3a,4,5,6,7,7a-hexahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.