CAS 17691-02-0
:P-aminophenyl-B-D-lactopyranoside
Description:
P-aminophenyl-β-D-lactopyranoside is a chemical compound characterized by its structure, which includes a β-D-lactopyranoside moiety linked to an amino group at the para position of a phenyl ring. This compound is typically used in biochemical applications, particularly as a substrate in enzyme assays, such as those involving glycosidases. Its structure allows it to participate in various chemical reactions, making it valuable in synthetic organic chemistry and biochemistry. The presence of the amino group contributes to its reactivity and solubility in polar solvents. Additionally, P-aminophenyl-β-D-lactopyranoside may exhibit biological activity, which can be explored in pharmacological studies. The compound is generally stable under standard laboratory conditions but should be handled with care, following appropriate safety protocols. As with many organic compounds, its properties can be influenced by factors such as pH and temperature, which may affect its solubility and reactivity in different environments.
Formula:C18H27NO11
InChI:InChI=1/C18H27NO11/c19-7-1-3-8(4-2-7)27-17-15(26)13(24)16(10(6-21)29-17)30-18-14(25)12(23)11(22)9(5-20)28-18/h1-4,9-18,20-26H,5-6,19H2/t9-,10-,11+,12+,13-,14-,15-,16-,17-,18+/m1/s1
Synonyms:- p-Aminophenyl--D-lactopyranoside
- 4-aminophenyl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside
- P-Aminophenyl beta-D-lactopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
p-Aminophenyl b-D-Lactopyranoside
CAS:Formula:C18H27NO11Purity:98.00%Color and Shape:SolidMolecular weight:433.4071p-Aminophenyl b-D-Lactopyranoside
CAS:Controlled Product<p>Applications A useful artificial carbohydrate protein conjugate that can be used as an antigen or immunogen.<br>References Roy, R., et al.: J. Chem Soc. Chem. Commun., 536 - 538 (1991)<br></p>Formula:C18H27NO11Color and Shape:NeatMolecular weight:433.414-Aminophenyl b-D-lactopyranoside
CAS:<p>4-Aminophenyl b-D-lactopyranoside is a chemical compound that has been used to optimize the production of human immunoglobulin. It has been shown to have diagnostic value for several viruses, including Epstein-Barr virus and cytomegalovirus. Electron microscopic studies have revealed organisms agglutinated by 4-aminophenyl b-D-lactopyranoside. The receptor binding properties and antigen concentration of this compound have been determined using agglutinin and lectin techniques. This molecule also has inhibitory potency on the synthesis of polypeptides, which are essential for the growth of certain organisms.</p>Formula:C18H27NO11Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:433.41 g/mol




