CAS 17692-45-4
:Quatacaine
Description:
Quatacaine, with the CAS number 17692-45-4, is a chemical compound that belongs to the class of local anesthetics. It is characterized by its ability to block nerve conduction, providing temporary loss of sensation in targeted areas. Quatacaine is typically used in medical and dental procedures to alleviate pain during interventions. Its mechanism of action involves the inhibition of sodium ion influx through voltage-gated sodium channels in neuronal cell membranes, which prevents the generation and propagation of action potentials. This compound is often formulated in various concentrations for specific applications, and its effectiveness can be influenced by factors such as pH and the presence of vasoconstrictors. Additionally, Quatacaine may exhibit a relatively rapid onset of action and a moderate duration of effect, making it suitable for short surgical procedures. As with all anesthetics, careful consideration of dosage and potential side effects is essential to ensure patient safety and efficacy during its use.
Formula:C14H22N2O
InChI:InChI=1/C14H22N2O/c1-5-10-15-14(3,4)13(17)16-12-9-7-6-8-11(12)2/h6-9,15H,5,10H2,1-4H3,(H,16,17)
SMILES:CCCNC(C)(C)C(=Nc1ccccc1C)O
Synonyms:- Quatacaine [INN]
- 2-Methyl-2-propylaminopropiono-o-toluide
- Quatacain
- Quatacaina
- Quatacaina [Spanish]
- Quatacainum
- Quatacainum [Latin]
- Unii-49Br7256Zy
- 2-Methyl-2-(propylamino)-o-propionotoluidide
- Propanamide, 2-methyl-N-(2-methylphenyl)-2-(propylamino)-
- o-Propionotoluidide, 2-methyl-2-(propylamino)-
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Quatacaine
CAS:Quatacaine is a local anesthetic.Formula:C14H22N2OColor and Shape:SolidMolecular weight:234.34
