CAS 176961-53-8

2-(4-BROMO-PHENYL)-1H-IMIDAZOLE

Description:

2-(4-Bromo-phenyl)-1H-imidazole is an organic compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a 4-bromophenyl group indicates that a bromine atom is substituted on the phenyl ring at the para position relative to the imidazole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of both the imidazole and bromine functionalities. Imidazole derivatives are known for their biological activity, and this particular compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. The bromine substituent can influence the compound's electronic properties and steric effects, potentially affecting its interactions with biological targets. Additionally, the compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which are crucial for its behavior in various chemical environments. Overall, 2-(4-bromo-phenyl)-1H-imidazole is a compound of interest for further research in both synthetic and medicinal chemistry.

Formula: C₉H₇BrN₂

InChI: InChI=1/C9H7BrN2/c10-8-3-1-7(2-4-8)9-11-5-6-12-9/h1-6H,(H,11,12)

SMILES: c1cc(ccc1c1[nH]ccn1)Br

Synonyms:

• 1H-imidazole, 2-(4-bromophenyl)-
• 2-(4-Bromophenyl)-1H-imidazole

1H-Imidazole, 2-(4-bromophenyl)-

CAS: 176961-53-8

Formula: C₉H₇BrN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 223.0693

Ref: IN-DA002511

2-(4-Bromophenyl)-1H-imidazole

CAS: 176961-53-8

2-(4-Bromophenyl)-1H-imidazole

Purity: 97%

Molecular weight: 223.073g/mol

Ref: 54-OR74355

2-(4-Bromophenyl)-1H-imidazole

CAS: 176961-53-8

Formula: C₉H₇BrN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 223.073

Ref: 10-F080180

2-(4-bromophenyl)-1H-imidazole

CAS: 176961-53-8

2-(4-Bromophenyl)-1H-imidazole is an impurity that has been found in the synthesis of 4-bromoaniline. Its luminescence properties and quantum yields have been studied using matrix-assisted laser desorption/ionization time-of-flight mass spectroscopy (MALDI TOF MS) and single photon counting methods. The efficiency of 2-(4-bromophenyl)-1H-imidazole's luminescence depends on the optical excitation wavelength, as well as its concentration. It is a phosphorescent compound with an emission maximum at 590 nm, which makes it useful for optoelectronic devices.

Formula: C₉H₇BrN₂

Purity: Min. 95%

Molecular weight: 223.07 g/mol

Ref: 3D-BHA96153