CAS 176967-80-9

5-Bromo-8-nitroquinoline

Description:

5-Bromo-8-nitroquinoline is a chemical compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. The presence of bromine and nitro functional groups at the 5 and 8 positions, respectively, significantly influences its chemical properties and reactivity. This compound typically exhibits a yellow to orange color and is soluble in organic solvents. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The nitro group can serve as a site for further chemical modifications, while the bromine atom can facilitate various coupling reactions. Additionally, 5-Bromo-8-nitroquinoline may exhibit biological activities, including antimicrobial or antitumor properties, making it of interest in research. As with many nitro compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Proper safety protocols should be followed when working with this substance in laboratory settings.

Formula: C₉H₅BrN₂O₂

InChI: InChI=1/C9H5BrN2O2/c10-7-3-4-8(12(13)14)9-6(7)2-1-5-11-9/h1-5H

SMILES: c1cc2c(ccc(c2nc1)N(=O)=O)Br

Synonyms:

• 5-Bromo-8-nitro-quinoline
• Quinoline, 5-Bromo-8-Nitro-

Quinoline, 5-bromo-8-nitro-

CAS: 176967-80-9

Formula: C₉H₅BrN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 253.0522

Ref: IN-DA00250X

5-Bromo-8-nitroquinoline

CAS: 176967-80-9

5-Bromo-8-nitroquinoline

Purity: 97%

Molecular weight: 253.06g/mol

Ref: 54-OR75214

5-Bromo-8-nitroquinoline

CAS: 176967-80-9

Formula: C₉H₅BrN₂O₂

Purity: 97%

Color and Shape: Liquid, No data available.

Molecular weight: 253.055

Ref: 10-F321385

5-Bromo-8-nitroquinoline

CAS: 176967-80-9

Versatile small molecule scaffold

Formula: C₉H₅BrN₂O₂

Purity: Min. 95%

Molecular weight: 253.05 g/mol

Ref: 3D-BHA96780