CAS 176970-12-0: (S)-3-N-CBZ-AMINOPYRROLIDINE
Description:(S)-3-N-CBZ-Aminopyrrolidine, with the CAS number 176970-12-0, is a chiral organic compound that belongs to the class of pyrrolidine derivatives. It features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and is substituted with a carbobenzyloxy (CBZ) group at the nitrogen atom. This modification enhances the compound's stability and solubility, making it useful in various synthetic applications, particularly in the field of medicinal chemistry. The presence of the chiral center allows for the potential development of enantiomerically pure compounds, which is crucial in drug design due to the differing biological activities of enantiomers. (S)-3-N-CBZ-Aminopyrrolidine is often utilized as an intermediate in the synthesis of more complex molecules, including pharmaceuticals. Its characteristics include a relatively low molecular weight, moderate polarity, and the ability to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions, making it a valuable building block in organic synthesis.
Formula:C12H16N2O2
InChI:InChI=1/C12H16N2O2/c15-12(14-11-6-7-13-8-11)16-9-10-4-2-1-3-5-10/h1-5,11,13H,6-9H2,(H,14,15)/t11-/m0/s1
- Synonyms:
- Benzyl (3S)-pyrrolidin-3-ylcarbamate
- Carbamic acid, N-[(3S)-3-pyrrolidinyl]-, phenylmethyl ester
- benzyl N-[(3S)-pyrrolidin-3-yl]carbamate
- (S)-3-(Cbz-aMino)pyrrolidine
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Carbamic acid, N-(3S)-3-pyrrolidinyl-, phenylmethyl ester REF: IN-DA00250TCAS: 176970-12-0 | 97% | 54.00 €~655.00 € | Wed 16 Apr 25 |
 | (S)-Benzyl pyrrolidin-3-ylcarbamate REF: 54-OR74789CAS: 176970-12-0 | 95% | 166.00 € | Thu 17 Apr 25 |
 | (S)-3-N-Cbz-aminopyrrolidine REF: 10-F040681CAS: 176970-12-0 | 97% | - - - | Discontinued product |
 | (S)-3-N-Cbz-aminopyrrolidine REF: 3D-FC149238CAS: 176970-12-0 | Min. 95% | - - - | Discontinued product |
Carbamic acid, N-(3S)-3-pyrrolidinyl-, phenylmethyl ester
Ref: IN-DA00250T
| 1g | 132.00 € | ||
| 5g | 225.00 € | ||
| 10g | 511.00 € | ||
| 25g | 655.00 € | ||
| 100mg | 54.00 € | ||
| 250mg | 65.00 € |
(S)-3-N-Cbz-aminopyrrolidine
Ref: 10-F040681
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information |
(S)-3-N-Cbz-aminopyrrolidine
Ref: 3D-FC149238
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
