CymitQuimica logo

CAS 176977-40-5

:

Silane, trimethyl[[4-[[4-[[4-[[4-[[tris(1-methylethyl)silyl]ethynyl]phenyl]ethynyl]phenyl]ethynyl]phenyl]ethynyl]phenyl]ethynyl]-

Description:
Silane, trimethyl[[4-[[4-[[4-[[4-[[tris(1-methylethyl)silyl]ethynyl]phenyl]ethynyl]phenyl]ethynyl]phenyl]ethynyl]phenyl]ethynyl]- (CAS 176977-40-5) is a complex organosilicon compound characterized by its extensive silane and ethynyl functional groups. This compound features a central silane moiety with three methyl groups attached, which enhances its stability and reactivity. The presence of multiple ethynyl-phenyl linkages contributes to its potential applications in organic electronics and materials science, particularly in the development of conductive polymers and light-emitting devices. The intricate structure allows for significant π-conjugation, which can influence its optical and electronic properties. Additionally, the bulky isopropyl groups provide steric hindrance, potentially affecting its solubility and interaction with other materials. Overall, this compound exemplifies the versatility of silane derivatives in advanced chemical applications, particularly in the fields of nanotechnology and polymer chemistry.
Formula:C46H46Si2
InChI:InChI=1S/C46H46Si2/c1-36(2)48(37(3)4,38(5)6)35-33-46-30-26-44(27-31-46)23-21-42-18-14-40(15-19-42)11-10-39-12-16-41(17-13-39)20-22-43-24-28-45(29-25-43)32-34-47(7,8)9/h12-19,24-31,36-38H,1-9H3
InChI key:InChIKey=IMOOOZCWGQHCRD-UHFFFAOYSA-N
SMILES:C(#C[Si](C(C)C)(C(C)C)C(C)C)C1=CC=C(C#CC2=CC=C(C#CC3=CC=C(C#CC4=CC=C(C#C[Si](C)(C)C)C=C4)C=C3)C=C2)C=C1
Synonyms:
  • Silane, trimethyl[[4-[[4-[[4-[[4-[[tris(1-methylethyl)silyl]ethynyl]phenyl]ethynyl]phenyl]ethynyl]phenyl]ethynyl]phenyl]ethynyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.