CAS 17699-14-8
:alpha-Cubebene
Description:
Alpha-Cubebene is a bicyclic monoterpene with the chemical formula C15H24, characterized by its unique structure that includes a cyclohexene ring. It is a colorless to pale yellow liquid with a characteristic odor, often described as spicy or woody. Alpha-Cubebene is primarily found in the essential oils of various plants, particularly in the cubeb pepper (Piper cubeba) and other members of the Piperaceae family. This compound is known for its potential applications in the fragrance industry due to its pleasant aroma. Additionally, alpha-Cubebene exhibits antimicrobial and antifungal properties, making it of interest in natural product research and potential therapeutic applications. Its boiling point and specific gravity can vary, but it is generally less dense than water. As with many terpenes, alpha-Cubebene is also studied for its role in plant defense mechanisms and its contribution to the overall scent profile of essential oils. Safety data indicates that it should be handled with care, as with other volatile organic compounds.
Formula:C15H24
InChI:InChI=1S/C15H24/c1-9(2)12-6-5-11(4)15-8-7-10(3)13(15)14(12)15/h7,9,11-14H,5-6,8H2,1-4H3/t11-,12+,13-,14-,15+/m1/s1
InChI key:InChIKey=XUEHVOLRMXNRKQ-KHMAMNHCSA-N
SMILES:C[C@H]1[C@]23[C@@]([C@]2(C(C)=CC3)[H])([C@H]([C@@H](C)C)CC1)[H]
Synonyms:- 3,7-dimethyl-4-(propan-2-yl)-3a,3b,4,5,6,7-hexahydro-1H-cyclopenta[1,3]cyclopropa[1,2]benzene
- (3aS,3bR,4S,7R,7aR)-3,7-dimethyl-4-(propan-2-yl)-3a,3b,4,5,6,7-hexahydro-1H-cyclopenta[1,3]cyclopropa[1,2]benzene
- 1H-Cyclopenta[1,3]cyclopropa[1,2]benzene, 3a,3b,4,5,6,7-hexahydro-3,7-dimethyl-4-(1-methylethyl)-, (3aS,3bR,4S,7R,7aR)-
- ()-alpha-Cubebene
- 1H-Cyclopenta[1,3]cyclopropa[1,2]benzene, 3a,3b,4,5,6,7-hexahydro-3,7-dimethyl-4-(1-methylethyl)-, [3aS-(3aα,3bβ,4β,7α,7aS*)]-
- 1H-Cyclopenta[1,3]cyclopropa[1,2]benzene, 3aα,3bα,4,5,6,7-hexahydro-4α-isopropyl-3,7β-dimethyl-, (-)-
- α-Cubebene, (-)-
- (3aS,3bR,4S,7R,7aR)-3a,3b,4,5,6,7-Hexahydro-3,7-dimethyl-4-(1-methylethyl)-1H-cyclopenta[1,3]cyclopropa[1,2]benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
