CAS 17700-09-3
:2,3,4-Trichloronitrobenzene
Description:
2,3,4-Trichloronitrobenzene is an aromatic compound characterized by the presence of three chlorine atoms and one nitro group attached to a benzene ring. Its molecular structure consists of a benzene ring substituted at the 2, 3, and 4 positions with chlorine atoms and a nitro group at one of the remaining positions. This compound is typically a yellow to brown solid at room temperature and is known for its relatively low solubility in water, but it is soluble in organic solvents such as acetone and chloroform. 2,3,4-Trichloronitrobenzene is primarily used in chemical synthesis and as an intermediate in the production of various dyes and pharmaceuticals. It exhibits toxic properties and potential environmental hazards, necessitating careful handling and disposal. The compound's reactivity is influenced by the electron-withdrawing nature of the nitro and chloro substituents, making it a subject of interest in studies related to environmental chemistry and toxicology.
Formula:C6H2Cl3NO2
InChI:InChI=1S/C6H2Cl3NO2/c7-3-1-2-4(10(11)12)6(9)5(3)8/h1-2H
InChI key:InChIKey=BGKIECJVXXHLDP-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(Cl)C(Cl)=C(Cl)C=C1
Synonyms:- 1,2,3-Trichloro-4-Nitrobenzene
- 1-Nitro-2,3,4-trichlorobenzene
- 2,3,4-Trichloro-1-nitrobenzene
- 2,3,4-Trichloronitrobenzole
- Benzene, 1,2,3-trichloro-4-nitro-
- NSC 91490
- 2,3,4-Trichloronitrobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2,3,4-Trichloronitrobenzene
CAS:Formula:C6H2Cl3NO2Purity:>99.0%(GC)Color and Shape:White to Light yellow to Green powder to crystalMolecular weight:226.44Benzene, 1,2,3-trichloro-4-nitro-
CAS:Formula:C6H2Cl3NO2Purity:98%Color and Shape:SolidMolecular weight:226.4446Ref: IN-DA00252B
500gTo inquire1g24.00€5g25.00€10g27.00€25g51.00€50g68.00€100g88.00€75g97.00€400g234.00€1,2,3-Trichloro-4-nitrobenzene
CAS:1,2,3-Trichloro-4-nitrobenzenePurity:98%Molecular weight:226.44g/mol2,3,4-Trichloronitrobenzene
CAS:Controlled ProductFormula:C6H2Cl3NO2Color and Shape:NeatMolecular weight:226.442,3,4-Trichloronitrobenzene
CAS:Controlled ProductApplications 2,3,4-Trichloronitrobenzene is a useful synthetic intermediate that is mainly used as the starting material in the synthesis of third generation quinolone antibacterial drugs, such as Lomefloxacin (L469415, HCl) and Ofloxacin (O245750). 2,3,4-Trichloronitrobenzene is also used as the starting material in the synthesis of Aclonifen (A190200); a compound used as a pesticide and herbicide.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Lu, Y., et al.: Guangdong Huagong, 36, 20 (2009); Laini, A., et al.: Sci. Total Environ., 438, 312 (2012); Fantke, P., et al.: Enviorn. Int., 49, 9 (2012)Formula:C6H2Cl3NO2Color and Shape:Off-WhiteMolecular weight:226.441,2,3-Trichloro-4-nitrobenzene
CAS:Formula:C6H2Cl3NO2Purity:98%Color and Shape:SolidMolecular weight:226.44






