CAS 177034-57-0
:4-[[2-(1-Methylethoxy)ethoxy]methyl]phenol
Description:
4-[[2-(1-Methylethoxy)ethoxy]methyl]phenol, identified by its CAS number 177034-57-0, is an organic compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a benzene ring. This compound features a complex ether side chain, specifically a 1-methylethoxy group linked through an ethoxy bridge. The presence of these functional groups suggests that it may exhibit properties typical of both phenols and ethers, such as potential antioxidant activity and solubility in organic solvents. The molecular structure indicates that it may have applications in various fields, including pharmaceuticals, cosmetics, or as a chemical intermediate. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall structure. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and risk management.
Formula:C12H18O3
InChI:InChI=1S/C12H18O3/c1-10(2)15-8-7-14-9-11-3-5-12(13)6-4-11/h3-6,10,13H,7-9H2,1-2H3
InChI key:InChIKey=ISQLWWCGQXEAJG-UHFFFAOYSA-N
SMILES:C(OCCOC(C)C)C1=CC=C(O)C=C1
Synonyms:- 4-Isopropoxyethoxymethyl-1-Hydroxybenzene
- Phenol, 4-[[2-(1-Methylethoxy)Ethoxy]Methyl]-
- 4-Isopropoxyethoxymethyphenol(Forbisoprolol)
- 4-Isopropoxyethoxymethyl-1-Hydroxybenzene(For Bisoprolol)
- 4-Isopropoxyethoxymethylphenol (Bisoprolol)
- 4-Isopropoxyethoxymethyphenol
- 4-[(2-Isopropoxyethoxy)Methyl]Phenol
- 4-{[2-(Propan-2-Yloxy)Ethoxy]Methyl}Phenol
- 4-[(2-Isopropoxy-ethoxy)methyl]phenol
- 4-[[2-(1-methylethoxy)ethoxy]methyl]Phenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4-((2-Isopropoxyethoxy)methyl)phenol
CAS:Formula:C12H18O3Purity:95%Color and Shape:LiquidMolecular weight:210.26954-(2-Isopropoxyethoxymethyl)phenol
CAS:4-(2-Isopropoxyethoxymethyl)phenolPurity:95%Color and Shape:LiquidMolecular weight:210.27g/mol4-[(2-Isopropoxyethoxy)methyl]phenol
CAS:Controlled ProductFormula:C12H18O3Color and Shape:NeatMolecular weight:210.274-[(2-Isopropoxyethoxy)methyl]phenol
CAS:Controlled ProductImpurity Bisoprolol EP Impurity M
Applications 4-[(2-Isopropoxyethoxy)methyl]phenol (Bisoprolol EP Impurity M) is an intermediate for the synthesis of Bisoprolol.
References Haeusler, G., et al.: J. Cardiovasc. Pharmacol., 8, S2 (1986), Dubois, E., et al.: J. Med. Chem., 39, 3256 (1996), Horikiri, Y., et al.: J. Pharm. Sci., 86, 560 (1997),Formula:C12H18O3Color and Shape:Colourless To Light YellowMolecular weight:210.274-Isopropoxyethoxymethyl-1-hydroxybenzene
CAS:4-Isopropoxyethoxymethyl-1-hydroxybenzene is a benzyl alcohol derivative that is synthesized by the reaction of 4-isopropoxyethoxymethylbenzene and sodium borohydride. This chemical compound has been used in the synthesis of bisoprolol, a cardioselective β1 adrenergic receptor blocker. It has also been used to synthesize phenolic compounds, such as hydroxybenzaldehyde and vanillin. The reaction time for this compound can be controlled by varying the amount of sodium borohydride used. The high yield obtained from this process makes it an industrially feasible method for large-scale production.br> 4-Isopropoxyethoxymethyl-1-hydroxybenzene is a white crystalline solid that does not dissolve in water but dissolves in organic solvents such as acetone or ethanol. It has an odorless and colorFormula:C12H18O3Purity:Min. 95%Molecular weight:210.27 g/mol






