CymitQuimica logo

CAS 177036-78-1

:

(S)-2-Hydroxy-3-methoxy-3,3-diphenylpropionic acid methyl ester

Description:
(S)-2-Hydroxy-3-methoxy-3,3-diphenylpropionic acid methyl ester, with CAS number 177036-78-1, is a chiral compound characterized by its specific stereochemistry, which is indicated by the (S) designation. This compound features a propionic acid backbone with a hydroxyl group and a methoxy group, along with two phenyl groups attached to the central carbon, contributing to its diphenyl structure. The presence of these functional groups suggests that it may exhibit interesting chemical reactivity and potential biological activity. As a methyl ester, it is likely to be more lipophilic, which can influence its solubility and permeability in biological systems. The compound's chirality may also play a significant role in its pharmacological properties, as different enantiomers can exhibit different biological effects. Overall, (S)-2-Hydroxy-3-methoxy-3,3-diphenylpropionic acid methyl ester is of interest in fields such as medicinal chemistry and drug development, where the understanding of stereochemistry is crucial for the design of effective therapeutic agents.
Formula:C17H18O4
InChI:InChI=1S/C17H18O4/c1-20-16(19)15(18)17(21-2,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,15,18H,1-2H3/t15-/m1/s1
InChI key:BEPLSLADXOJCBY-OAHLLOKOSA-N
SMILES:COC(=O)[C@H](C(C1=CC=CC=C1)(C2=CC=CC=C2)OC)O
Synonyms:
  • Methyl (2S)-2-hydroxy-3-methoxy-3,3-diphenylpropanoate
  • (S)-2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid methyl ester
  • (S)-2-Hydroxy-3-Methoxy-3,3-Diphenylpropanoic Acid Methyl Ester (Ambrisentan)
Found 5 products.