CAS 17705-30-5
:2,2-Dichloro-1,1,3,3-tetrafluoropropane
Description:
2,2-Dichloro-1,1,3,3-tetrafluoropropane, commonly referred to by its CAS number 17705-30-5, is a halogenated organic compound primarily used as a refrigerant and in various industrial applications. This substance is characterized by its molecular structure, which includes two chlorine atoms and four fluorine atoms attached to a propane backbone. It is a colorless gas or liquid at room temperature, with a relatively low boiling point, making it suitable for refrigeration processes. The presence of multiple halogen atoms contributes to its stability and low flammability, but also raises concerns regarding its environmental impact, particularly in relation to ozone depletion and greenhouse gas effects. Additionally, 2,2-Dichloro-1,1,3,3-tetrafluoropropane exhibits low solubility in water and is more soluble in organic solvents. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, its unique properties make it valuable in specific applications while necessitating responsible management due to its environmental implications.
Formula:C3H2Cl2F4
InChI:InChI=1/C3H2Cl2F4/c4-3(5,1(6)7)2(8)9/h1-2H
SMILES:C(C(C(F)F)(Cl)Cl)(F)F
Synonyms:- Propane, 2,2-dichloro-1,1,3,3-tetrafluoro-
- Brn 1921790
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2,2-Dichloro-1,1,3,3-Tetrafluoropropane
CAS:Controlled Product<p>2,2-Dichloro-1,1,3,3-Tetrafluoropropane (DCTF) is a fluorinated ether that is used in laboratories as an anaesthetic or gas. It has been shown to be a potent inhibitor of respiration in animals and is also used to produce nitrous oxide. DCTF inhibits the enzyme cytochrome oxidase by binding to its heme group and prevents the formation of oxygen from hydrogen. DCTF is not metabolized by the body and has a half-life of about 40 minutes.</p>Formula:C3H2Cl2F4Purity:Min. 95%Molecular weight:184.95 g/mol

