CAS 1770782-39-2

(9S,11bS)-1,8,9,11b-Tetrahydro-7,11-dihydroxy-3,4,9,11b-tetramethylphenanthro[3,2-b]furan-6(2H)-one

Description:

The chemical substance known as "(9S,11bS)-1,8,9,11b-Tetrahydro-7,11-dihydroxy-3,4,9,11b-tetramethylphenanthro[3,2-b]furan-6(2H)-one" with CAS number 1770782-39-2 is a complex organic compound characterized by its unique polycyclic structure, which includes a phenanthro-furan framework. This compound features multiple chiral centers, contributing to its stereochemistry and potentially influencing its biological activity. The presence of hydroxyl groups indicates that it may exhibit polar characteristics, which can affect its solubility and reactivity in various environments. Additionally, the tetramethyl substitution suggests that it may have significant steric hindrance, impacting its interactions with other molecules. Such compounds are often of interest in medicinal chemistry and natural product synthesis due to their potential therapeutic properties. However, specific biological activities, stability, and reactivity would require further investigation through experimental studies to fully understand its characteristics and applications.

Formula: C₂₀H₂₂O₄

InChI: InChI=1S/C20H22O4/c1-9-5-6-20(4)13(11(9)3)8-14(21)15-16(20)18(23)19-12(17(15)22)7-10(2)24-19/h8,10,22-23H,5-7H2,1-4H3/t10-,20-/m0/s1

InChI key: InChIKey=IQGPVLVWUUPQMQ-FVINQWEUSA-N

SMILES: C[C@@]12C=3C(=C(O)C4=C(C3O)O[C@@H](C)C4)C(=O)C=C1C(C)=C(C)CC2

Synonyms:

• Uncinatone
• (9S,11bS)-1,8,9,11b-Tetrahydro-7,11-dihydroxy-3,4,9,11b-tetramethylphenanthro[3,2-b]furan-6(2H)-one
• Phenanthro[3,2-b]furan-6(2H)-one, 1,8,9,11b-tetrahydro-7,11-dihydroxy-3,4,9,11b-tetramethyl-, (9S,11bS)-
• 2-Deoxycaryopincaolide F

Phenanthro[3,2-b]furan-6(2H)-one, 1,8,9,11b-tetrahydro-7,11-dihydroxy-3,4,9,11b-tetramethyl-, (9S,11bS)-

CAS: 1770782-39-2

Formula: C₂₀H₂₂O₄

Molecular weight: 326.3863

Ref: IN-DA01O2I2

Uncinatone

CAS: 1770782-39-2

Uncinatone is a natural product from the stems and roots of Clerodendrum philippinum var. simplex

Formula: C₂₀H₂₂O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 326.392

Ref: TM-TN2410

(11bS)-7,11-Dihydroxy-3,4,9,11b-tetramethyl-1,2,8,9-tetrahydronaphtho[2,1-F][1]benzofuran-6-one

Controlled Product

CAS: 1770782-39-2

(11bS)-7,11-Dihydroxy-3,4,9,11b-tetramethyl-1,2,8,9-tetrahydronaphtho[2,1-F][1]benzofuran-6-one is a medicinal compound that has shown inhibitory activity against human cancer cells. It has been tested on various cancer cell lines and has demonstrated potent anti-proliferative effects. The compound specifically targets tumor cells and has the potential to be developed into a novel class of inhibitors for the treatment of cancer. In vitro studies have shown that (11bS)-7,11-Dihydroxy-3,4,9,11b-tetramethyl-1,2,8,9-tetrahydronaphtho[2,1-F][1]benzofuran-6-one can inhibit the growth of human cancer cell lines through its interaction with specific proteins involved in cell proliferation.

Formula: C₂₀H₂₂O₄

Purity: Min. 95%

Molecular weight: 326.4 g/mol

Ref: 3D-VVC78239