CAS 17708-79-1

N-cbz-val-leu

Description:

N-Cbz-Val-Leu, also known as N-carbobenzyloxy-valine-leucine, is a dipeptide derivative characterized by the presence of a carbobenzyloxy (Cbz) protecting group on the valine residue. This compound is typically used in peptide synthesis and research due to its stability and ability to protect amino groups during chemical reactions. The Cbz group enhances the lipophilicity of the molecule, facilitating its incorporation into various biochemical applications. N-Cbz-Val-Leu is generally soluble in organic solvents such as dichloromethane and dimethylformamide, while its solubility in water is limited. The compound exhibits typical peptide bond characteristics, including the ability to undergo hydrolysis under acidic or basic conditions, which can be exploited in synthetic pathways. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry and drug development. As with many peptide derivatives, careful handling and storage are recommended to maintain its integrity and prevent degradation.

Formula: C₁₉H₂₈N₂O₅

InChI: InChI=1/C19H28N2O5/c1-12(2)10-15(18(23)24)20-17(22)16(13(3)4)21-19(25)26-11-14-8-6-5-7-9-14/h5-9,12-13,15-16H,10-11H2,1-4H3,(H,20,22)(H,21,25)(H,23,24)

SMILES: CC(C)CC(C(=O)O)N=C(C(C(C)C)N=C(O)OCc1ccccc1)O

Synonyms:

• Z-Val-Leu-OH
• N-[(benzyloxy)carbonyl]valylleucine

Z-Val-Leu-OH

CAS: 17708-79-1

Z-Val-Leu-OH is a model substrate for plant proteases, aminopeptidases and dipeptidases. It has been used as a standard to study the mechanism of hydrolysis by these enzymes. Z-Val-Leu-OH is hydrolyzed by these enzymes at optimally pH 8.0, with the rate increasing with temperature up to 45°C. The hydrolysis of Z-Val-Leu-OH by germination endosperm proteinase is inhibited by hemoglobin, which leads to increased levels of peptides in the endosperm.

Formula: C₁₉H₂₈N₂O₅

Purity: Min. 95%

Molecular weight: 364.44 g/mol

Ref: 3D-FV111530