
CAS 17716-89-1
:Benzoic acid, 2-hydroxy-, 3-(2,5-dimethyl-1-pyrrolidinyl)propyl ester
Description:
Benzoic acid, 2-hydroxy-, 3-(2,5-dimethyl-1-pyrrolidinyl)propyl ester, commonly known by its CAS number 17716-89-1, is an organic compound characterized by its ester functional group derived from benzoic acid and a pyrrolidine derivative. This compound features a hydroxyl group (–OH) at the ortho position relative to the carboxylic acid group, which contributes to its solubility and reactivity. The presence of the pyrrolidine moiety enhances its potential biological activity and may influence its pharmacokinetic properties. Typically, esters like this one exhibit moderate polarity, making them soluble in organic solvents while having limited solubility in water. The compound may be utilized in various applications, including pharmaceuticals, where it could serve as an intermediate or active ingredient due to its potential therapeutic properties. Its stability, reactivity, and specific interactions with biological systems would depend on the overall molecular structure and the presence of functional groups, making it a subject of interest in medicinal chemistry and drug design.
Formula:C16H23NO3
InChI:InChI=1S/C16H23NO3/c1-12-8-9-13(2)17(12)10-5-11-20-16(19)14-6-3-4-7-15(14)18/h3-4,6-7,12-13,18H,5,8-11H2,1-2H3
InChI key:InChIKey=TVNKQHWRADJSQD-UHFFFAOYSA-N
SMILES:C(CCOC(=O)C1=C(O)C=CC=C1)N2C(C)CCC2C
Synonyms:- Benzoic acid, 2-hydroxy-, 3-(2,5-dimethyl-1-pyrrolidinyl)propyl ester
- Pranosal
- 1-Pyrrolidinepropanol, 2,5-dimethyl-, salicylate (ester)
- Salicylic acid, 3-(2,5-dimethyl-1-pyrrolidinyl)propyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzoic acid, 2-hydroxy-, 3-(2,5-dimethyl-1-pyrrolidinyl)propyl ester
CAS:Formula:C16H23NO3Molecular weight:277.3587
