
CAS 177172-49-5
:3-(2-Chlorophenyl)-N-[1(R)-(3-methoxyphenyl)ethyl]propylamine hydrochloride
Description:
3-(2-Chlorophenyl)-N-[1(R)-(3-methoxyphenyl)ethyl]propylamine hydrochloride, with the CAS number 177172-49-5, is a chemical compound that belongs to the class of amines. It features a propylamine backbone substituted with a 2-chlorophenyl group and a chiral 3-methoxyphenyl ethyl group, indicating its potential for specific interactions in biological systems. The presence of the hydrochloride salt form suggests enhanced solubility in aqueous environments, which is often advantageous for pharmacological applications. This compound may exhibit properties relevant to medicinal chemistry, particularly in the context of drug design and development, potentially acting on neurotransmitter systems due to its amine structure. Its chiral center implies that it could have different biological activities depending on the stereochemistry, which is a critical consideration in the development of therapeutic agents. Overall, this compound's unique structural features may contribute to its biological activity, making it a subject of interest in research related to pharmacology and medicinal chemistry.
Formula:C18H23Cl2NO
InChI:InChI=1/C18H22ClNO.ClH/c1-14(16-8-5-10-17(13-16)21-2)20-12-6-9-15-7-3-4-11-18(15)19;/h3-5,7-8,10-11,13-14,20H,6,9,12H2,1-2H3;1H/t14-;/m1./s1
SMILES:C[C@H](c1cccc(c1)OC)NCCCc1ccccc1Cl.Cl
Synonyms:- Tecalcet hydrochloride
- Krn-568
- R-568
- Nps-R-568
- Norcalcin
- 3-(2-chlorophenyl)-N-[(1R)-1-(3-methoxyphenyl)ethyl]propan-1-amine hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzenepropanamine, 2-chloro-N-[(1R)-1-(3-methoxyphenyl)ethyl]-, hydrochloride (1:1)
CAS:Formula:C18H23Cl2NOPurity:%Color and Shape:SolidMolecular weight:340.2873(R)-3-(2-Chlorophenyl)-N-(1-(3-Methoxyphenyl)Ethyl)Propan-1-Amine Hydrochloride
CAS:(R)-3-(2-Chlorophenyl)-N-(1-(3-Methoxyphenyl)Ethyl)Propan-1-Amine HydrochloridePurity:98+%Molecular weight:340.29g/molTecalcet Hydrochloride
CAS:Tecalcet hydrochloride is a drug that has been used to treat hyperparathyroidism, which is a condition in which the parathyroid gland produces too much of the hormone parathyroid hormone (PTH). PTH controls the amount of calcium in the blood by regulating its release from bones. Tecalcet hydrochloride reduces the production of PTH and increases the absorption of calcium from food. Tecalcet hydrochloride is used to prevent or treat adhesions that can develop after abdominal surgery and other medical procedures. It also helps to reduce or prevent calcifications or deposits on organs such as kidneys, lungs, and heart. This drug binds to calcium ions at sites outside cells and prevents them from entering cells where they can cause damage. Tecalcet hydrochloride also binds to subunits of podocytes (cells in the kidney's filtering system) and inhibits their function, leading to osteopenia.Formula:C18H23Cl2NOPurity:Min. 95%Molecular weight:340.29 g/molTecalcet Hydrochloride
CAS:Tecalcet Hydrochloride, an allosteric CaSR modulator, enhances extracellular Ca2+ sensitivity.Formula:C18H23Cl2NOPurity:99.97%Color and Shape:SolidMolecular weight:340.29Ref: TM-T13918
200mgTo inquire2mg34.00€5mg47.00€1mL*10mM (DMSO)52.00€10mg72.00€25mg146.00€50mg230.00€100mg335.00€



