CAS 17719-89-0
:Bucinnazine
Description:
Bucinnazine, with the CAS number 17719-89-0, is a chemical compound that belongs to the class of phenothiazine derivatives. It is primarily recognized for its use as an antipsychotic medication, exhibiting properties that can help manage symptoms of various psychiatric disorders. The compound functions by modulating neurotransmitter activity in the brain, particularly affecting dopamine receptors. Bucinnazine is characterized by its ability to provide therapeutic effects while potentially minimizing side effects commonly associated with other antipsychotic drugs. Its chemical structure includes a phenothiazine core, which contributes to its pharmacological activity. Additionally, Bucinnazine has been studied for its sedative and anxiolytic properties, making it a versatile option in psychiatric treatment. As with many pharmaceuticals, the safety profile, dosage, and potential interactions with other medications are important considerations in its use. Overall, Bucinnazine represents a significant compound in the field of psychopharmacology, contributing to the management of mental health conditions.
Formula:C17H24N2O
InChI:InChI=1S/C17H24N2O/c1-2-7-17(20)19-14-12-18(13-15-19)11-6-10-16-8-4-3-5-9-16/h3-6,8-10H,2,7,11-15H2,1H3
InChI key:InChIKey=ZQBMUHABRSEAIK-UHFFFAOYSA-N
SMILES:C(C=CC1=CC=CC=C1)N2CCN(C(CCC)=O)CC2
Synonyms:- 1-[4-(3-Phenyl-2-propen-1-yl)-1-piperazinyl]-1-butanone
- 1-Butanone, 1-[4-(3-phenyl-2-propen-1-yl)-1-piperazinyl]-
- Piperazine, 1-(1-oxobutyl)-4-(3-phenyl-2-propenyl)-
- 1-Butyryl-4-cinnamylpiperazine
- Piperazine, 1-butyryl-4-cinnamyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Butanone, 1-[4-(3-phenyl-2-propen-1-yl)-1-piperazinyl]-
CAS:Formula:C17H24N2OMolecular weight:272.3853
