CAS 1772-76-5: 2-Propenoic acid, 3-(3-nitrophenyl)-, (E)-

Description:2-Propenoic acid, 3-(3-nitrophenyl)-, (E)-, also known as 3-(3-nitrophenyl)acrylic acid, is an organic compound characterized by its acrylate structure, featuring a double bond between the first and second carbon atoms of the propenoic acid backbone. The presence of a nitrophenyl group at the third carbon introduces significant electronic effects, making it a useful compound in various chemical applications, including as a building block in organic synthesis and materials science. This compound typically exhibits properties such as being a solid at room temperature, with moderate solubility in polar solvents due to the presence of the carboxylic acid functional group. Its E configuration indicates the specific geometric arrangement around the double bond, which can influence its reactivity and interactions with other molecules. Additionally, the nitro group can enhance the compound's reactivity in electrophilic aromatic substitution reactions. Safety data should be consulted, as nitro compounds can pose health risks, and appropriate handling precautions are necessary.

Formula:C₉H₇NO₄

InChI:InChI=1S/C9H7NO4/c11-9(12)5-4-7-2-1-3-8(6-7)10(13)14/h1-6H,(H,11,12)/b5-4+

InChI key:InChIKey=WWXMVRYHLZMQIG-SNAWJCMRSA-N

SMILES:O=C(O)C=CC1=CC=CC(=C1)N(=O)=O

Found 4 products.

Product data	Purity	Price range	Estimated delivery
(E)-3-Nitrocinnamic Acid REF: 3B-N0354CAS: 1772-76-5 555-68-0	>98.0%(GC)(T)	27.00 €~71.00 €	Tue 01 Apr 25
2-Propenoic acid, 3-(3-nitrophenyl)-, (2E)- REF: IN-DA00ALAICAS: 1772-76-5	97%	26.00 €~582.00 €	Tue 08 Apr 25
(E)-3-(3-Nitrophenyl)Acrylic Acid REF: 54-OR1008339CAS: 1772-76-5	99%	32.00 €~2,025.00 €	Wed 09 Apr 25
trans-3-Nitrocinnamic acid REF: 3D-FN38644CAS: 1772-76-5	Min. 95%	143.00 €~2,026.00 €	Mon 21 Apr 25