CAS 177202-83-4

2-PYRIDIN-3-YLANILINE

Description:

2-Pyridin-3-ylaniline, with the CAS number 177202-83-4, is an organic compound characterized by the presence of both a pyridine ring and an aniline structure. This compound features a pyridine ring substituted at the 3-position with an aniline group, which consists of an amino group (-NH2) attached to a phenyl ring. The presence of the nitrogen atoms in both the pyridine and aniline moieties contributes to its potential as a ligand in coordination chemistry and its utility in various organic synthesis reactions. 2-Pyridin-3-ylaniline may exhibit properties such as moderate solubility in polar solvents and potential reactivity due to the amino group, which can participate in hydrogen bonding and nucleophilic reactions. Additionally, the compound may display biological activity, making it of interest in pharmaceutical research. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₁H₁₀N₂

InChI: InChI=1/C11H10N2/c12-11-6-2-1-5-10(11)9-4-3-7-13-8-9/h1-8H,12H2

SMILES: c1ccc(c(c1)c1cccnc1)N

Synonyms:

• 2-(Pyridin-3-yl)aniline 95%

Benzenamine, 2-(3-pyridinyl)-

CAS: 177202-83-4

Formula: C₁₁H₁₀N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 170.2105

Ref: IN-DA00256H

2-(Pyridin-3-yl)aniline

CAS: 177202-83-4

2-(Pyridin-3-yl)aniline

Formula: C₁₁H₁₀N₂

Purity: 95%

Color and Shape: brown low melting solid

Molecular weight: 170.21g/mol

Ref: 54-OR3875

2-(Pyridin-3-yl)aniline

CAS: 177202-83-4

Formula: C₁₁H₁₀N₂

Purity: 95%

Molecular weight: 170.215

Ref: 10-F226529