CAS 177210-33-2

5-Hydroxy-2H-1,4-benzoxazin-3(4H)-one

Description:

5-Hydroxy-2H-1,4-benzoxazin-3(4H)-one, with the CAS number 177210-33-2, is a chemical compound that belongs to the class of benzoxazinoids, which are known for their role in plant defense mechanisms. This compound features a benzoxazine ring structure, characterized by a fused benzene and oxazine moiety, along with a hydroxyl group at the 5-position. It is typically found in certain plant species, particularly in the Poaceae family, where it contributes to the plant's resistance against herbivores and pathogens. The presence of the hydroxyl group enhances its reactivity and potential for forming hydrogen bonds, which may influence its biological activity. Additionally, benzoxazinoids are known for their antimicrobial and antifungal properties, making them of interest in agricultural and pharmaceutical research. The compound's solubility, stability, and reactivity can vary based on environmental conditions, and it may undergo various transformations in biological systems, contributing to its ecological significance.

Formula: C₈H₇NO₃

InChI: InChI=1/C8H7NO3/c10-5-2-1-3-6-8(5)9-7(11)4-12-6/h1-3,10H,4H2,(H,9,11)

SMILES: c1cc(c2c(c1)OCC(=N2)O)O

Synonyms:

• 2H-1,4-benzoxazin-3(4H)-one, 5-hydroxy-
• 5-Hydroxy-2H-benzo[b][1,4]oxazin-3(4H)-one
• 5-HYDROXY-2H-1,4-BENZOXAZIN-3(4H)-ONE

2H-1,4-Benzoxazin-3(4H)-one, 5-hydroxy-

CAS: 177210-33-2

Formula: C₈H₇NO₃

Purity: %

Molecular weight: 165.1461

Ref: IN-DA00256G

5-Hydroxy-2H-1,4-benzoxazin-3(4H)-one

CAS: 177210-33-2

5-Hydroxy-2H-1,4-benzoxazin-3(4H)-one

Purity: 96%

Molecular weight: 165.15g/mol

Ref: 54-OR907081

5-Hydroxy-2H-1,4-benzoxazin-3(4H)-one

CAS: 177210-33-2

Formula: C₈H₇NO₃

Purity: 95.0%

Color and Shape: Solid, solid

Molecular weight: 165.148

Ref: 10-F076190