CAS 1773-37-1
:carbasulam
Description:
Carbasulam, identified by its CAS number 1773-37-1, is a chemical compound primarily recognized for its application as a herbicide. It belongs to the class of sulfonylureas, which are known for their ability to inhibit specific enzymes involved in plant growth. The compound exhibits characteristics typical of herbicides, including selective toxicity to certain plant species while being less harmful to others, making it valuable in agricultural practices. Carbasulam functions by disrupting the synthesis of essential amino acids, thereby affecting the growth and development of target weeds. It is generally applied in various formulations, often in combination with other herbicides to enhance efficacy. The compound is typically characterized by its stability under normal environmental conditions, although its persistence can vary based on soil type and climatic factors. Safety assessments indicate that, like many agrochemicals, it should be handled with care to minimize environmental impact and ensure human safety. Overall, carbasulam is an important tool in modern agriculture for weed management.
Formula:C10H12N2O6S
InChI:InChI=1/C10H12N2O6S/c1-17-9(13)11-7-3-5-8(6-4-7)19(15,16)12-10(14)18-2/h3-6H,1-2H3,(H,11,13)(H,12,14)
SMILES:COC(=O)Nc1ccc(cc1)S(=O)(=O)N=C(O)OC
Synonyms:- Methyl 4-(Methoxycarbonylsulphamoyl)Carbanilate
- Methyl ({4-[(Methoxycarbonyl)Amino]Phenyl}Sulfonyl)Carbamate
- acetylasulam
- N--4--benzolsulfonamid
- carbasulam
- methyl N-[4-(methoxycarbonylamino)phenyl]sulfonylcarbamate
- Carbamic acid, N-[[4-[(methoxycarbonyl)amino]phenyl]sulfonyl]-, methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Carbamic acid, N-[[4-[(methoxycarbonyl)amino]phenyl]sulfonyl]-, methyl ester
CAS:Formula:C10H12N2O6SMolecular weight:288.2771Carbasulam
CAS:Carbasulam is an anticancer drug that inhibits the growth of cancer cells by inducing apoptosis. It acts by binding to protein kinases, which are enzymes that play a crucial role in cell signaling and regulation. Carbasulam has been shown to be effective in inhibiting the growth of tumors in human and Chinese hamster ovary cells. It is a medicinal analog of urine-derived kinase inhibitors, which have been used as potential anticancer agents. Carbasulam is a potent inhibitor of several kinases involved in cancer cell proliferation, including Akt, ERK1/2, and JNK1/2. Its ability to selectively target these kinases makes it a promising candidate for the treatment of various types of cancer.
Formula:C10H12N2O6SPurity:Min. 95%Molecular weight:288.28 g/mol

