CAS 1773-44-0: O-tolualdehyde 2,4-dinitrophenylhydrazone
Description:O-tolualdehyde 2,4-dinitrophenylhydrazone, with the CAS number 1773-44-0, is a chemical compound formed from the reaction of O-tolualdehyde and 2,4-dinitrophenylhydrazine. It is characterized by its yellow crystalline appearance, which is typical for many hydrazones due to the presence of the dinitrophenyl group. This compound is primarily used in organic synthesis and analytical chemistry, particularly in the identification and characterization of aldehydes and ketones through the formation of hydrazones. The presence of the dinitrophenyl group enhances its reactivity and solubility in various organic solvents. O-tolualdehyde 2,4-dinitrophenylhydrazone exhibits stability under standard laboratory conditions but should be handled with care due to the potential toxicity of its components. Its melting point and solubility characteristics can vary based on purity and environmental conditions. Overall, this compound serves as a useful derivative in the study of carbonyl compounds and their derivatives in organic chemistry.
Formula:C14H12N4O4
InChI:InChI=1/C14H12N4O4/c1-10-4-2-3-5-11(10)9-15-16-13-7-6-12(17(19)20)8-14(13)18(21)22/h2-9,16H,1H3
o-Tolualdehyde 2,4-Dinitrophenylhydrazone
Ref: 3B-T1447
| 1g | 85.00 € | ||
| 10g | 503.00 € |
Benzaldehyde, 2-methyl-, 2-(2,4-dinitrophenyl)hydrazone
Ref: IN-DA002584
| 1g | 112.00 € | ||
| 5g | 312.00 € | ||
| 100mg | 59.00 € | ||
| 250mg | 61.00 € |
o-Tolualdehyd-2,4-dinitrophenylhydrazone
Controlled ProductRef: 04-C17593015
| 100mg | To inquire |
HJ 1154-2020 Aldehyde-DNPHs and Ketone-DNPHs Mixture 347 100 µg/mL in Acetonitrile
Ref: 04-A50000350AL
| 1ml | To inquire |
DNPH-Mix 2 215-700 µg/mL in Acetonitrile
Ref: 04-YA18001611AL
| 1ml | 218.00 € |
DNPH-Mix 1, 100 µg/mL in Acetonitrile
Ref: 04-XA18001607AL
| 1ml | 210.00 € |
HJ 683-2014 Carbonyl DNPH as Aldehyde/Ketone Mixture 493 15 µg/mL in Acetonitrile
Ref: 04-A50000493AL
| 1ml | To inquire |
Aldehyde/Ketone-DNPH Mixture 537 15 µg/mL in Acetonitrile
Ref: 04-A50000537AL
| 1ml | To inquire |
Derivatized Carbonyl Compounds 879 Mixture 100 µg/mL in Acetonitrile
Ref: 04-GA09000879AL
| 1ml | 208.00 € |
EPA Method 8315 DNPH Mixture 451 100 µg/mL in Acetonitrile
Ref: 04-A50000451AL
| 1ml | To inquire |
DNPH mixture for HJ 400-2007 100 µg/mL in Acetonitrile
Ref: 04-GA09000589AL
| 1ml | 156.00 € |
(E)-1-(2,4-dinitrophenyl)-2-(2-methylbenzylidene)hydrazine
Ref: 10-F771312
| 1g | 91.00 € |
o-Tolualdehyde 2,4-Dinitrophenylhydrazone
Ref: 3D-BAA77344
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information | |
| 50g | Discontinued | Request information |
