CAS 177317-28-1

Bicyclo[3.1.0]hexane-2,6-dicarboxylic acid, 2-amino- (9CI)

Description:

Bicyclo[3.1.0]hexane-2,6-dicarboxylic acid, 2-amino- (9CI), with the CAS number 177317-28-1, is a bicyclic organic compound characterized by its unique bicyclic structure, which consists of a six-membered ring with two carboxylic acid functional groups and an amino group. This compound features a rigid framework due to the bicyclic arrangement, which can influence its reactivity and interactions with other molecules. The presence of the two carboxylic acid groups makes it a dicarboxylic acid, contributing to its acidity and potential for forming salts or esters. The amino group introduces basicity and can participate in hydrogen bonding, enhancing its solubility in polar solvents. This compound may be of interest in various fields, including organic synthesis, pharmaceuticals, and materials science, due to its potential applications in creating more complex molecules or as a building block in polymer chemistry. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined through experimental data.

Formula: C₈H₁₁NO₄

InChI: InChI=1/C8H11NO4/c9-8(7(12)13)2-1-3-4(5(3)8)6(10)11/h3-5H,1-2,9H2,(H,10,11)(H,12,13)

SMILES: C1CC(C2C1C2C(=O)O)(C(=O)O)N

Synonyms:

• Ly 354740
• 2-Aminobicyclo[3.1.0]Hexane-2,6-Dicarboxylic Acid

2-Aminobicyclo[3.1.0]hexane-2,6-dicarboxylic acid

CAS: 177317-28-1

Formula: C₈H₁₁NO₄

Molecular weight: 185.1772

Ref: IN-DA00258N

Eglumegad

CAS: 177317-28-1

Formula: C₈H₁₁NO₄

Molecular weight: 185.18

Ref: 7W-GP8717