CymitQuimica logo

CAS 17741-13-8

:

N-Phenylpyrrolidin-3-amine

Description:
N-Phenylpyrrolidin-3-amine, with the CAS number 17741-13-8, is an organic compound characterized by its pyrrolidine ring structure substituted with a phenyl group and an amino group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the phenyl group contributes to its aromatic characteristics, potentially affecting its reactivity and interaction with biological systems. N-Phenylpyrrolidin-3-amine may be of interest in medicinal chemistry due to its structural features, which could impart specific pharmacological activities. Additionally, its molecular structure suggests potential applications in the synthesis of more complex organic molecules or as a building block in drug development. As with many amines, it may also exhibit varying degrees of toxicity and should be handled with appropriate safety precautions in laboratory settings.
Formula:C10H14N2
InChI:InChI=1/C10H14N2/c1-2-4-9(5-3-1)12-10-6-7-11-8-10/h1-5,10-12H,6-8H2
SMILES:c1ccc(cc1)NC1CCNC1
Synonyms:
  • 3-Pyrrolidinamine, N-phenyl-
  • N-Phenylpyrrolidin-3-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.