CAS 17742-51-7
:4-PHENYLSULFANYL-BUTYRIC ACID
Description:
4-Phenylsulfanyl-butyric acid, with the CAS number 17742-51-7, is an organic compound characterized by the presence of a butyric acid moiety and a phenylsulfanyl group. This compound typically exhibits properties associated with both carboxylic acids and thioethers. It is likely to be a white to off-white solid at room temperature, with moderate solubility in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. The presence of the phenylsulfanyl group may impart unique reactivity, potentially allowing for nucleophilic substitution reactions or participation in various organic synthesis pathways. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its melting point, boiling point, and specific reactivity would depend on the molecular interactions and the environment in which it is studied. As with many organic compounds, safety precautions should be taken when handling 4-phenylsulfanyl-butyric acid, including the use of appropriate personal protective equipment.
Formula:C10H11O2S
InChI:InChI=1/C10H12O2S/c11-10(12)7-4-8-13-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H,11,12)/p-1
InChI key:HHZVQLOVHIDMBD-UHFFFAOYSA-N
SMILES:c1ccc(cc1)SCCCC(=O)[O-]
Synonyms:- Butanoic acid, 4-(phenylthio)-
- Nsc 115787
- 4-(Phenylsulfanyl)Butanoic Acid
- 4-(Phenylsulfanyl)Butanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-(Phenylthio)butanoic acid
CAS:4-(Phenylthio)butanoic acidFormula:C10H12O2SPurity:97%Molecular weight:196.274-(Phenylthio)butanoic acid
CAS:Formula:C10H12O2SPurity:97%Color and Shape:SolidMolecular weight:196.26614-(Phenylthio)butanoic acid
CAS:4-(Phenylthio)butanoic acidFormula:C10H12O2SPurity:97%Molecular weight:196.274-(Phenylsulfanyl)butanoic acid
CAS:Formula:C10H12O2SPurity:97%Color and Shape:SolidMolecular weight:196.264-(Phenylsulfanyl)butanoic acid
CAS:4-(Phenylsulfanyl)butanoic acid is an analog of retinoic acid, which is a metabolite of vitamin A. This drug has been shown to have both activating and inhibitory effects on the kidney cell, depending on the concentration. It has been shown to be effective in reducing acute kidney injury in rats by inhibiting the production of inflammatory cytokines. 4-(Phenylsulfanyl)butanoic acid has also been shown to activate N-acetylglucosamine kinase, which plays an important role in protein synthesis and cell division. The pharmacophore for this drug is a phenylsulfanyl group with a butanoyl chain. This drug binds to a protein target, which activates or inhibits various proteins that are involved in cellular processes such as protein synthesis, cell division, and activation of inflammatory cytokines.Formula:C10H12O2SPurity:Min. 95%Molecular weight:196.26 g/mol




