CAS 1774898-65-5
:2-Cyclobutyl-7-fluoro-1H-benzimidazole-1-acetic acid
Description:
2-Cyclobutyl-7-fluoro-1H-benzimidazole-1-acetic acid is a chemical compound characterized by its unique structural features, which include a benzimidazole core substituted with a cyclobutyl group and a fluorine atom. This compound typically exhibits properties associated with benzimidazole derivatives, such as potential biological activity, including antimicrobial or anti-inflammatory effects. The presence of the cyclobutyl group may influence its lipophilicity and steric properties, potentially affecting its interaction with biological targets. The fluorine atom can enhance the compound's metabolic stability and bioactivity. As an acetic acid derivative, it may also exhibit acidic properties, which can influence its solubility and reactivity in various environments. Overall, the characteristics of this compound suggest it may be of interest in medicinal chemistry and drug development, although specific biological activities and applications would require further investigation through experimental studies.
Formula:C13H13FN2O2
InChI:InChI=1S/C13H13FN2O2/c14-9-5-2-6-10-12(9)16(7-11(17)18)13(15-10)8-3-1-4-8/h2,5-6,8H,1,3-4,7H2,(H,17,18)
InChI key:InChIKey=BOFRZOIFRMXYAK-UHFFFAOYSA-N
SMILES:C(C(O)=O)N1C=2C(N=C1C3CCC3)=CC=CC2F
Synonyms:- 1H-Benzimidazole-1-acetic acid, 2-cyclobutyl-7-fluoro-
- 2-Cyclobutyl-7-fluoro-1H-benzimidazole-1-acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
