CAS 1775-97-9
:Flavokawain B
Description:
Flavokawain B is a natural compound classified as a flavokawain, which is a type of chalcone. It is primarily derived from the plant species *Kava* (Piper methysticum), known for its traditional use in various cultures for its psychoactive properties. The chemical structure of Flavokawain B features a characteristic chalcone backbone, which consists of two aromatic rings connected by a three-carbon α,β-unsaturated carbonyl system. This compound exhibits a range of biological activities, including anti-inflammatory, antioxidant, and potential anticancer properties, making it a subject of interest in pharmacological research. Flavokawain B is also noted for its ability to modulate various cellular pathways, which may contribute to its therapeutic effects. Its solubility and stability can vary depending on the solvent and environmental conditions, influencing its bioavailability and efficacy in biological systems. As with many natural compounds, further studies are needed to fully elucidate its mechanisms of action and potential applications in medicine.
Formula:C17H16O4
InChI:InChI=1S/C17H16O4/c1-20-13-10-15(19)17(16(11-13)21-2)14(18)9-8-12-6-4-3-5-7-12/h3-11,19H,1-2H3/b9-8+
InChI key:InChIKey=QKQLSQLKXBHUSO-CMDGGOBGSA-N
SMILES:C(/C=C/C1=CC=CC=C1)(=O)C2=C(OC)C=C(OC)C=C2O
Synonyms:- (2E)-1-(2-Hydroxy-4,6-dimethoxyphenyl)-3-phenyl-2-propen-1-one
- (2E)-1-(2-hydroxy-4,6-dimethoxyphenyl)-3-phenylprop-2-en-1-one
- (E)-1-(2-Hydroxy-4,6-Dimethoxy-Phenyl)-3-Phenyl-Propenone
- (E)-1-(2-Hydroxy-4,6-dimethoxy-phenyl)-3-phenyl-
- (E)-1-(2-Hydroxy-4,6-dimethoxyphenyl)-3-phenylprop-2-en-1-one
- (E)-2′-Hydroxy-4′,6′-dimethoxychalcone
- 1-(2-Hydroxy-4,6-Dimethoxyphenyl)-3-Phenyl-2-Propen-1-One)
- 2-Propen-1-one, 1-(2-hydroxy-4,6-dimethoxyphenyl)-3-phenyl-, (2E)-
- 2-Propen-1-one, 1-(2-hydroxy-4,6-dimethoxyphenyl)-3-phenyl-, (E)-
- Cardamonin-4'-Methyl Ether
- Chalcone, 2′-hydroxy-4′,6′-dimethoxy-
- Dimethoxy-2'-Hydroxychalcone, 4',6'-
- Flavokavain B
- Flavokavin B
- Flavokawain B
- Flavokawin B
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Flavokawain B
CAS:Flavokawain B analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C17H16O4Purity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:284.312-Propen-1-one, 1-(2-hydroxy-4,6-dimethoxyphenyl)-3-phenyl-, (2E)-
CAS:Formula:C17H16O4Purity:98%Color and Shape:SolidMolecular weight:284.3065Flavokawain B
CAS:Flavokawain B, the hepatotoxic constituent from kava root, induces GSH-sensitive oxidative stress through modulation of IKK/NF-κB and MAPK signaling pathways. Flavokawain B has potent anti-inflammatory, and anti-cancer activities, it can significantly inhibit production of NO and PGE2 in LPS-induced RAW 264.7 cells. Flavokawain B acts through ROS generation and GADD153 up-regulation to regulate the expression of Bcl-2 family members, thereby inducing mitochondrial dysfunction and apoptosis in HCT116 cells.Formula:C17H16O4Purity:95%~99%Color and Shape:Yellow powderMolecular weight:284.311Flavokawain B
CAS:Flavokawain B inhibits NO and PGE2, causes oxidative stress, and induces apoptosis, with potential for treating prostate cancer.Formula:C17H16O4Purity:99.94% - >99.99%Color and Shape:SolidMolecular weight:284.31Flavokawain b
CAS:Ketone phenolFormula:C17H16O4Purity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:284.314',6'-Dimethoxy-2'-hydroxychalcone
CAS:4',6'-Dimethoxy-2'-hydroxychalcone is a chalcone compound, which is a type of flavonoid. Flavonoids are polyphenolic compounds synthesized by plants. This particular compound is typically derived from various plant sources, where it plays a role in the plant's defense mechanisms. As a chalcone, it contains a characteristic open-chain framework that distinguishes it from other flavonoids.Formula:C17H16O4Purity:Min. 95%Molecular weight:284.31 g/molFlavokavain B
CAS:Controlled ProductApplications Flavokavain B is a secondary metabolite of the kava plant (Piper methysticum Forst. f., Piperaceae, which has anticancer properties and demonstrated oral efficacy in murine cancer models. Futhermore, it also has suspected roles in rare cases of kava-induced hepatotoxicity. In addition, it is a potential candidate for the development of novel antifungal phytotherapic products.
References Pinner, K. D., et al.: Pharmaceutical Biology (Abingdon, United Kingdom), 54, Epub ahead of print (2016); Rowe A., et al.: Phytotherapy Research, 26, 1768 (2012); Alves dos Santos, R., et al.: Journal of Chemistry, (2013)Formula:C17H16O4Color and Shape:Yellow To Dark YellowMolecular weight:284.31








