CAS 17755-52-1

1-(2-PYRIDYL)-2-(3-PYRIDYL)-ETHYLENE

Description:

1-(2-PYRIDYL)-2-(3-PYRIDYL)-ETHYLENE, with the CAS number 17755-52-1, is an organic compound characterized by its dual pyridine rings attached to an ethylene backbone. This compound features a conjugated system, which can contribute to its electronic properties and potential reactivity. The presence of the pyridine rings, which are aromatic heterocycles containing nitrogen, imparts unique characteristics such as increased polarity and the ability to participate in hydrogen bonding. This compound may exhibit interesting biological activities and can be utilized in various chemical syntheses or as a ligand in coordination chemistry. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, or materials science. Additionally, the compound's stability and solubility can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, 1-(2-PYRIDYL)-2-(3-PYRIDYL)-ETHYLENE is a noteworthy compound in the realm of organic chemistry due to its structural complexity and potential utility.

Formula: C₁₂H₁₀N₂

InChI: InChI=1/C12H10N2/c1-2-9-14-12(5-1)7-6-11-4-3-8-13-10-11/h1-10H

SMILES: c1ccnc(c1)C=Cc1cccnc1

Synonyms:

• 2-[2-(Pyridin-3-Yl)Ethenyl]Pyridine

Pyridine, 2-[2-(3-pyridinyl)ethenyl]-

CAS: 17755-52-1

Formula: C₁₂H₁₀N₂

Molecular weight: 182.2212

Ref: IN-DA0025EB