CAS 17758-11-1
:5-bromo-2-ethoxypyrimidine
Description:
5-Bromo-2-ethoxypyrimidine is a heterocyclic organic compound characterized by the presence of a pyrimidine ring substituted with a bromine atom at the 5-position and an ethoxy group at the 2-position. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water due to its non-polar ethoxy group. The presence of the bromine atom introduces notable reactivity, making it a useful intermediate in various organic synthesis reactions, including nucleophilic substitutions and coupling reactions. Additionally, the ethoxy group can influence the compound's electronic properties and steric hindrance, affecting its reactivity and interactions with biological systems. 5-Bromo-2-ethoxypyrimidine is often utilized in pharmaceutical research and development, particularly in the synthesis of biologically active compounds. As with many halogenated compounds, appropriate safety measures should be taken when handling this substance due to potential toxicity and environmental concerns.
Formula:C6H7BrN2O
InChI:InChI=1/C6H7BrN2O/c1-2-10-6-8-3-5(7)4-9-6/h3-4H,2H2,1H3
SMILES:CCOc1ncc(cn1)Br
Synonyms:- Pyrimidine, 5-bromo-2-ethoxy-
- 5-Bromo-2-ethoxypyrimidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Bromo-2-ethoxypyrimidine
CAS:Formula:C6H7BrN2OPurity:98%Color and Shape:SolidMolecular weight:203.03665-Bromo-2-ethoxypyrimidine
CAS:5-Bromo-2-ethoxypyrimidinePurity:≥95%Color and Shape:PowderMolecular weight:203.04g/mol5-Bromo-2-ethoxypyrimidine
CAS:Formula:C6H7BrN2OPurity:98%Color and Shape:Liquid, No data available.Molecular weight:203.0395-Bromo-2-ethoxypyrimidine
CAS:5-Bromo-2-ethoxypyrimidine is a heterocyclic compound that can be synthesized from 2-ethoxy pyrimidine and bromine. It is a colorless to light yellowish liquid that has a boiling point of 150°C. 5-Bromo-2-ethoxypyrimidine is an alkoxide that can be prepared by the reaction of uracil and perfluoroalkyl acid. It undergoes hydrolysis when treated with acid, forming hydrogen bromide and ethyl cyanoacetate.Formula:C6H7BrN2OPurity:Min. 95%Molecular weight:203.04 g/mol



