CAS 177583-27-6
:tert-Butyl (trans-4-aminomethylcyclohexyl)carbamate
Description:
Tert-Butyl (trans-4-aminomethylcyclohexyl)carbamate is an organic compound characterized by its carbamate functional group, which is derived from the reaction of an amine with a carbonyl compound. This substance features a tert-butyl group, providing steric hindrance that can influence its reactivity and solubility. The presence of the trans-4-aminomethylcyclohexyl moiety indicates a specific stereochemistry that can affect the compound's biological activity and interactions. Typically, compounds like this may exhibit moderate to high polarity due to the presence of both hydrophilic (amine and carbamate) and hydrophobic (tert-butyl) components. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where it may serve as a building block or a pharmacophore. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, tert-Butyl (trans-4-aminomethylcyclohexyl)carbamate represents a versatile compound with potential utility in various chemical and biological contexts.
Formula:C12H24N2O2
InChI:InChI=1/C12H24N2O2/c1-12(2,3)16-11(15)14-10-6-4-9(8-13)5-7-10/h9-10H,4-8,13H2,1-3H3,(H,14,15)/t9-,10-
SMILES:CC(C)(C)OC(=N[C@H]1CC[C@@H](CC1)CN)O
Synonyms:- Tert-Butyl Trans-4-Aminomethylcyclohexylcarbamate
- Tert-Butyl Trans-L-4-Aminomethyl Cyclohexyl Carbamate
- Tert-Butyltrans-L-4-Aminomethylcyclohexycarbamate
- tert-butyl N-[4-(aminomethyl)cyclohexyl]carbamate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
trans-4-(Boc-amino)cyclohexanemethylamine, 97%
CAS:<p>trans-4-(Boc-amino)cyclohexanemethylamine is used as a raw material intermediates for pharmaceutical and chemical. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The origi</p>Formula:C12H24N2O2Purity:97%Molecular weight:228.33tert-Butyl (trans-4-aminomethylcyclohexyl)carbamate
CAS:Formula:C12H24N2O2Purity:95%Color and Shape:SolidMolecular weight:228.3312tert-Butyl (trans-4-(aminomethyl)cyclohexyl)carbamate
CAS:<p>tert-Butyl (trans-4-(aminomethyl)cyclohexyl)carbamate</p>Purity:95%Molecular weight:228.33g/moltert-Butyl (trans-4-(aminomethyl)cyclohexyl)carbamate
CAS:Formula:C12H24N2O2Purity:95%Color and Shape:SolidMolecular weight:228.336




