CAS 1776-53-0: 4-Aminocyclohexanecarboxylic acid
Description:4-Aminocyclohexanecarboxylic acid, also known as L-lysine, is an organic compound characterized by its cyclohexane ring structure with an amino group and a carboxylic acid functional group. This compound is a colorless to pale yellow solid that is soluble in water, reflecting its polar nature due to the presence of both amino and carboxylic acid groups. It exhibits basic properties due to the amino group, allowing it to participate in acid-base reactions. The compound is known for its role in biological systems, particularly as an essential amino acid in protein synthesis. Its structure allows for various interactions, including hydrogen bonding, which contributes to its solubility and reactivity. Additionally, 4-Aminocyclohexanecarboxylic acid can be involved in various chemical reactions, such as esterification and amidation, making it a valuable intermediate in organic synthesis. Its applications extend to pharmaceuticals, where it may serve as a building block for drug development or as a dietary supplement in nutrition.
Formula:C7H13NO2
InChI:InChI=1S/C7H13NO2/c8-6-3-1-5(2-4-6)7(9)10/h5-6H,1-4,8H2,(H,9,10)
InChI key:InChIKey=DRNGLYHKYPNTEA-UHFFFAOYSA-N
SMILES:O=C(O)C1CCC(N)CC1
- Synonyms:
- 4-Amino-1-cyclohexanecarboxylic acid
- 4-Aminocyclohexylcarboxylic acid
- Cyclohexanecarboxylic acid, 4-amino-
- trans-4-Aminocyclohexanecarboxylic acid
- 4-Aminocyclohexanecarboxylic acid

4-Aminocyclohexanecarboxylic Acid (cis- and trans- mixture)
Ref: 3B-A1278
5g | 80.00 € | ||
25g | 264.00 € |

Cyclohexanecarboxylic acid, 4-amino-
Ref: IN-DA0025EZ
1g | 24.00 € | ||
5g | 58.00 € | ||
25g | 150.00 € | ||
250mg | 24.00 € |

4-Aminocyclohexane-1-carboxylic acid
Ref: 54-OR17541
1g | 36.00 € | ||
5g | 55.00 € | ||
25g | 181.00 € | ||
100g | 619.00 € | ||
500g | 2,771.00 € | ||
250mg | 32.00 € |

4-Aminocyclohexanecarboxylic acid (cis/trans mixture)
Ref: 10-F013927
1g | 25.00 € | ||
5g | 78.00 € | ||
10g | 97.00 € | ||
25g | 157.00 € | ||
100g | 542.00 € | ||
250mg | 20.00 € |

4-AminocycLohexanecarboxyLic acid
Ref: 3D-FA43911
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information |