CAS 177653-76-8

4-METHYL-3-[(1-METHYL-4-NITRO-1H-IMIDAZOL-5-YL)THIO]-4H-1,2,4-TRIAZOLE

Description:

4-Methyl-3-[(1-methyl-4-nitro-1H-imidazol-5-yl)thio]-4H-1,2,4-triazole is a chemical compound characterized by its complex structure, which includes a triazole ring and an imidazole moiety. This compound features a methyl group and a nitro group, contributing to its unique chemical properties and potential biological activity. The presence of the thioether linkage enhances its reactivity and solubility in various solvents. It is often studied for its potential applications in pharmaceuticals, particularly in the development of antifungal agents or other therapeutic compounds. The compound's molecular structure allows for interactions with biological targets, making it of interest in medicinal chemistry. Additionally, its CAS number, 177653-76-8, provides a unique identifier for regulatory and research purposes. As with many heterocyclic compounds, its synthesis and characterization are crucial for understanding its reactivity and potential applications in various fields, including agriculture and medicine.

Formula: C₇H₈N₆O₂S

InChI: InChI=1/C7H8N6O2S/c1-11-3-8-5(13(14)15)6(11)16-7-10-9-4-12(7)2/h3-4H,1-2H3

SMILES: Cn1cnc(c1Sc1nncn1C)N(=O)=O

Synonyms:

• Mnitmt
• 4-methyl-3-[(1-methyl-4-nitro-1H-imidazol-5-yl)sulfanyl]-4H-1,2,4-triazole

4H-1,2,4-Triazole, 4-methyl-3-[(1-methyl-4-nitro-1H-imidazol-5-yl)thio]-

CAS: 177653-76-8

Formula: C₇H₈N₆O₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 240.2424

Ref: IN-DA0025FA

MNITMT

CAS: 177653-76-8

MNITMT

Purity: ≥98%

Molecular weight: 240.24g/mol

Ref: 54-BUP05966

MNITMT

CAS: 177653-76-8

MNITMT is a potent immunosuppressive agent without bone marrow toxicity [1].

Formula: C₇H₈N₆O₂S

Purity: 99.82%

Color and Shape: Solid

Molecular weight: 240.24

Ref: TM-T9603

4-Methyl-3-((1-methyl-4-nitro-1H-imidazol-5-yl)thio)-4H-1,2,4-triazole

CAS: 177653-76-8

Purity: ≥98%

Molecular weight: 240.2400055

Ref: 10-F870499