CAS 17768-28-4
:1,3-Adamantanediacetic acid
Description:
1,3-Adamantanediacetic acid, with the CAS number 17768-28-4, is a chemical compound characterized by its unique adamantane structure, which consists of a diamond-like cage of carbon atoms. This compound features two carboxylic acid groups (-COOH) attached to the first and third carbon atoms of the adamantane framework, making it a diacid. It is typically a white crystalline solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid groups. The compound exhibits interesting chemical properties, including the ability to form salts and esters, and it can participate in various chemical reactions typical of carboxylic acids. Its structural rigidity and functional groups may contribute to its potential applications in pharmaceuticals, materials science, and as a building block in organic synthesis. Additionally, the compound's unique structure may influence its biological activity and interactions, making it a subject of interest in medicinal chemistry.
Formula:C14H20O4
InChI:InChI=1S/C14H20O4/c15-11(16)6-13-2-9-1-10(4-13)5-14(3-9,8-13)7-12(17)18/h9-10H,1-8H2,(H,15,16)(H,17,18)
InChI key:InChIKey=UTENGZNBNPABQE-UHFFFAOYSA-N
SMILES:C(C(O)=O)C12CC3(CC(O)=O)CC(C1)CC(C2)C3
Synonyms:- 1,3-Bis(carboxymethyl)adamantane
- 2,2'-Tricyclo[3.3.1.1~3,7~]Decane-1,3-Diyldiacetic Acid
- 2,2′-(Adamantane-1,3-diyl)diacetic acid
- 2-[3-(Carboxymethyl)-1-adamantyl]acetic acid
- 2-[3-(Carboxymethyl)adamantan-1-yl]acetic acid
- Tricyclo(3.3.1.13,7)dec-1,3-diyldi(acetic acid)
- Tricyclo[3.3.1.1<sup>3,7</sup>]decane-1,3-diacetic acid
- Tricyclo[3.3.1.13,7]decane-1,3-diacetic acid
- 1,3-Adamantanediacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,3-Adamantanediacetic Acid
CAS:Formula:C14H20O4Purity:>98.0%(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:252.31Tricyclo[3.3.1.13,7]decane-1,3-diacetic acid
CAS:Formula:C14H20O4Purity:98%Color and Shape:SolidMolecular weight:252.30622,2'-(Adamantane-1,3-Diyl)Diacetic Acid
CAS:2,2'-(Adamantane-1,3-Diyl)Diacetic AcidPurity:97%Molecular weight:252.31g/mol1,3-Adamantanediacetic acid
CAS:1,3-Adamantanediacetic acid is a linker molecule that is used in analytical chemistry. It is a bifunctional reagent that reacts with trifluoroacetic acid and triflic acid to form a chelate ring. This reaction product can be analyzed using analytical methods such as gas chromatography or nuclear magnetic resonance spectroscopy. 1,3-Adamantanediacetic acid has been shown to react with amides and hydrogen bonding interactions to form supramolecular structures. The introduction of this compound into the synthesis of peptides has allowed for the elucidation of the structural analysis of these molecules.Formula:C14H20O4Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:252.31 g/mol2,2′-(Adamantane-1,3-diyl)diacetic acid
CAS:Formula:C14H20O4Purity:98%Color and Shape:SolidMolecular weight:252.31




