CAS 17768-34-2
:3-Bromo-1-adamantaneacetic acid
Description:
3-Bromo-1-adamantaneacetic acid is a chemical compound characterized by its unique adamantane structure, which is a polycyclic hydrocarbon known for its stability and rigidity. This compound features a bromine atom substituted at the 3-position of the adamantane framework, along with an acetic acid functional group. The presence of the bromine atom can influence the compound's reactivity and solubility, while the carboxylic acid group contributes to its acidic properties. Typically, compounds like 3-bromo-1-adamantaneacetic acid are of interest in medicinal chemistry and materials science due to their potential biological activities and applications in drug development. The molecular structure allows for various interactions, making it a candidate for further research in synthetic chemistry and pharmacology. Additionally, the compound's stability and unique properties may facilitate its use in the development of novel materials or as a building block in organic synthesis.
Formula:C12H16BrO2
InChI:InChI=1/C12H17BrO2/c13-12-4-8-1-9(5-12)3-11(2-8,7-12)6-10(14)15/h8-9H,1-7H2,(H,14,15)/p-1/t8-,9-,11?,12?/m1/s1
SMILES:C1[C@@H]2CC3(C[C@@H]1CC(C2)(C3)Br)CC(=O)[O-]
Synonyms:- (3-Bromo-1-adamantyl)acetic acid, 3-Bromotricyclo[3.3.1.13,7]decane-1-acetic acid
- 3-Bromoadamantane-1-acetic acid
- (3-Bromotricyclo[3.3.1.1~3,7~]Dec-1-Yl)Acetic Acid
- [(5R,7R)-3-bromotricyclo[3.3.1.1~3,7~]dec-1-yl]acetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Tricyclo[3.3.1.13,7]decane-1-acetic acid, 3-bromo-
CAS:Formula:C12H17BrO2Purity:97%Color and Shape:SolidMolecular weight:273.16623-Bromoadamantane-1-acetic acid
CAS:3-Bromoadamantane-1-acetic acid is a crystalline solid that has a molecular weight of 168.2 and a melting point of 202°C. It has three polymorphs, with the dihydrate being the most stable form at room temperature. 3-Bromoadamantane-1-acetic acid is an efficacious molecule that can be used to treat bacterial infections as well as fungal infections. This drug also has been shown to have low toxicity in animal studies, with no adverse effects on the liver or kidney observed after repeated administration.Formula:C12H17BrO2Purity:Min. 95%Molecular weight:273.17 g/mol

