CAS 177735-09-0
:3-Methylthiophene-2-boronic acid
Description:
3-Methylthiophene-2-boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a thiophene ring, specifically at the 2-position, with a methyl group at the 3-position. This compound typically exhibits properties associated with both boronic acids and thiophene derivatives, including potential applications in organic synthesis and materials science. The boronic acid group allows for participation in Suzuki-Miyaura cross-coupling reactions, making it valuable in the formation of carbon-carbon bonds. Additionally, the thiophene ring contributes to the compound's electronic properties, which can be beneficial in organic electronics and as a building block in the synthesis of more complex molecules. The presence of the methyl group can influence the compound's solubility and reactivity. Overall, 3-Methylthiophene-2-boronic acid is a versatile compound with significant utility in various chemical applications, particularly in the development of organic semiconductors and pharmaceuticals.
Formula:C5H7BO2S
InChI:InChI=1/C5H7BO2S/c1-4-2-3-9-5(4)6(7)8/h2-3,7-8H,1H3
SMILES:Cc1ccsc1B(O)O
Synonyms:- Akos B003946
- 3-Methyl-2-thienylboronic acid
- 3-Methyl-2-thiopheneboronic acid
- (3-Methylthiophen-2-Yl)Boronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Methylthiophene-2-boronic acid, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C5H7BO2SPurity:98%Molecular weight:141.98Boronic acid, B-(3-methyl-2-thienyl)-
CAS:Formula:C5H7BO2SPurity:98%Color and Shape:SolidMolecular weight:141.98393-Methylthiophene-2-boronic acid
CAS:<p>3-Methylthiophene-2-boronic acid</p>Formula:C5H7BO2SPurity:98%Color and Shape: white solidMolecular weight:141.98g/mol(3-Methylthiophen-2-yl)boronic acid
CAS:Formula:C5H7BO2SPurity:95%Color and Shape:SolidMolecular weight:141.98




