CAS 17783-50-5
:8-METHYL-3,8-DIAZA-BICYCLO[3.2.1]OCTANE DIHYDROCHLORIDE
Description:
8-Methyl-3,8-diaza-bicyclo[3.2.1]octane dihydrochloride is a chemical compound characterized by its bicyclic structure, which includes two nitrogen atoms incorporated into the bicyclic framework. This compound is a derivative of bicyclic amines and is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the dihydrochloride indicates that the compound exists as a salt, which can enhance its solubility and stability in various solvents. Its molecular structure contributes to its unique properties, including its ability to interact with biological systems, making it of interest in drug design. The compound's characteristics, such as its melting point, solubility, and reactivity, are influenced by the functional groups present and the overall molecular geometry. Safety data sheets and handling guidelines should be consulted for information on toxicity and safe handling practices, as with any chemical substance.
Formula:C7H14N2
InChI:InChI=1/C7H14N2/c1-9-6-2-3-7(9)5-8-4-6/h6-8H,2-5H2,1H3
SMILES:CN1C2CCC1CNC2
Synonyms:- 8-Methyl-3,8-Diazabicyclo[3.2.1]Octane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,8-Diazabicyclo[3.2.1]octane, 8-methyl-, hydrochloride (1:2)
CAS:Formula:C7H16Cl2N2Purity:98%Color and Shape:SolidMolecular weight:199.1213Ref: IN-DA0025L6
1g268.00€5gTo inquire10gTo inquire50gTo inquire100gTo inquire100mg110.00€250mg145.00€8-Methyl-3,8-Diazabicyclo[3.2.1]Octane Dihydrochloride
CAS:8-Methyl-3,8-Diazabicyclo[3.2.1]Octane DihydrochloridePurity:95%Molecular weight:199.12g/mol8-Methyl-3,8-diazabicyclo[3.2.1]octane dihydrochloride
CAS:8-Methyl-3,8-diazabicyclo[3.2.1]octane dihydrochloride is a high quality reagent that is used as an intermediate in the synthesis of complex compounds. This compound has been shown to be useful as a scaffold for the synthesis of new compounds and is also a versatile building block for reactions in organic chemistry. 8-Methyl-3,8-diazabicyclo[3.2.1]octane dihydrochloride is also used as a speciality chemical and research chemical in various fields such as pharmaceuticals, agrochemicals, and other industries.Formula:C7H16Cl2N2Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:199.12 g/mol8-Methyl-3,8-diaza-bicyclo[3.2.1]octane dihydrochloride
CAS:Formula:C7H16Cl2N2Purity:97%Color and Shape:SolidMolecular weight:199.12



