CymitQuimica logo

CAS 177842-14-7

:

4-(difluoromethoxy)benzylamine

Description:
4-(Difluoromethoxy)benzylamine is an organic compound characterized by its benzylamine structure, where a difluoromethoxy group is attached to the para position of the benzene ring. This compound features a benzene ring substituted with an amine group (-NH2) and a difluoromethoxy group (-O-CHF2), which contributes to its unique chemical properties. The presence of fluorine atoms enhances the compound's lipophilicity and may influence its reactivity and interaction with biological systems. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The compound may exhibit moderate solubility in organic solvents and limited solubility in water due to the hydrophobic nature of the difluoromethoxy group. Its potential applications could span various fields, including pharmaceuticals and agrochemicals, where such functional groups are often explored for their biological activity. Safety data should be consulted for handling and usage, as the presence of fluorine can impart specific hazards.
Formula:C8H9F2NO
InChI:InChI=1/C8H9F2NO/c9-8(10)12-7-3-1-6(5-11)2-4-7/h1-4,8H,5,11H2
InChI key:UHWPLNHRROQPMB-UHFFFAOYSA-N
SMILES:c1cc(ccc1CN)OC(F)F
Synonyms:
  • 1-[4-(Difluoromethoxy)Phenyl]Methanamine
Found 4 products.